C12H18N4OS — CID 127770607
6-methyl-N-(1,3-thiazol-2-yl)-3,3a,4,5,7,7a-hexahydro-2H-pyrrolo[2,3-c]pyridine-1-carboxamide (PubChem CID 127770607) has the molecular formula C12H18N4OS and a molecular weight of 266.37 g/mol. Its IUPAC name is 6-methyl-N-(1,3-thiazol-2-yl)-3,3a,4,5,7,7a-hexahydro-2H-pyrrolo[2,3-c]pyridine-1-carboxamide.
| Compound Name | 6-methyl-N-(1,3-thiazol-2-yl)-3,3a,4,5,7,7a-hexahydro-2H-pyrrolo[2,3-c]pyridine-1-carboxamide |
|---|---|
| PubChem CID | 127770607 |
| Molecular Formula | C12H18N4OS |
| Molecular Weight | 266.37 g/mol |
| Exact Mass | 266.12 |
| IUPAC Name | 6-methyl-N-(1,3-thiazol-2-yl)-3,3a,4,5,7,7a-hexahydro-2H-pyrrolo[2,3-c]pyridine-1-carboxamide |
| SMILES | CN1CCC2CCN(C(=O)Nc3nccs3)C2C1 |
| InChI | InChI=1S/C12H18N4OS/c1-15-5-2-9-3-6-16(10(9)8-15)12(17)14-11-13-4-7-18-11/h4,7,9-10H,2-3,5-6,8H2,1H3,(H,13,14,17) |
| InChIKey | YIIYOZHSONORBC-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 48.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.37 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |