C24H23NO5 — CID 12777191
diethyl 1-benzoyl-4-phenyl-4H-pyridine-3,5-dicarboxylate (PubChem CID 12777191) has the molecular formula C24H23NO5 and a molecular weight of 405.40 g/mol. Its IUPAC name is diethyl 1-benzoyl-4-phenyl-4H-pyridine-3,5-dicarboxylate.
| Compound Name | diethyl 1-benzoyl-4-phenyl-4H-pyridine-3,5-dicarboxylate |
|---|---|
| PubChem CID | 12777191 |
| Molecular Formula | C24H23NO5 |
| Molecular Weight | 405.40 g/mol |
| Exact Mass | 405.16 |
| IUPAC Name | diethyl 1-benzoyl-4-phenyl-4H-pyridine-3,5-dicarboxylate |
| SMILES | CCOC(=O)C1=CN(C=C(C1C2=CC=CC=C2)C(=O)OCC)C(=O)C3=CC=CC=C3 |
| InChI | InChI=1S/C24H23NO5/c1-3-29-23(27)19-15-25(22(26)18-13-9-6-10-14-18)16-20(24(28)30-4-2)21(19)17-11-7-5-8-12-17/h5-16,21H,3-4H2,1-2H3 |
| InChIKey | MAMZQJZREZDYQK-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 72.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | 662 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.40 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |