About 5-fluoro-1-propan-2-yl-3,6-dihydro-2H-pyridine
5-fluoro-1-propan-2-yl-3,6-dihydro-2H-pyridine (PubChem CID 127772956) has the molecular formula C8H14FN
and a molecular weight of 143.21 g/mol. Its IUPAC name is 5-fluoro-1-propan-2-yl-3,6-dihydro-2H-pyridine.
Molecular Properties
| Compound Name | 5-fluoro-1-propan-2-yl-3,6-dihydro-2H-pyridine |
| PubChem CID | 127772956 |
| Molecular Formula | C8H14FN |
| Molecular Weight | 143.21 g/mol |
| Exact Mass | 143.11 |
| IUPAC Name | 5-fluoro-1-propan-2-yl-3,6-dihydro-2H-pyridine |
| SMILES | CC(C)N1CCC=C(F)C1 |
| InChI | InChI=1S/C8H14FN/c1-7(2)10-5-3-4-8(9)6-10/h4,7H,3,5-6H2,1-2H3 |
| InChIKey | GACZXSBYRCIIJF-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 143.21 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 5-fluoro-1-propan-2-yl-3,6-dihydro-2H-pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-fluoro-1-propan-2-yl-3,6-dihydro-2H-pyridine?
The IUPAC name of 5-fluoro-1-propan-2-yl-3,6-dihydro-2H-pyridine (CID 127772956) is 5-fluoro-1-propan-2-yl-3,6-dihydro-2H-pyridine.
What is the SMILES notation for 5-fluoro-1-propan-2-yl-3,6-dihydro-2H-pyridine?
The canonical SMILES for 5-fluoro-1-propan-2-yl-3,6-dihydro-2H-pyridine is CC(C)N1CCC=C(F)C1.
What is the InChIKey of 5-fluoro-1-propan-2-yl-3,6-dihydro-2H-pyridine?
The InChIKey is GACZXSBYRCIIJF-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14FN/c1-7(2)10-5-3-4-8(9)6-10/h4,7H,3,5-6H2,1-2H3.
What are the key properties of 5-fluoro-1-propan-2-yl-3,6-dihydro-2H-pyridine?
5-fluoro-1-propan-2-yl-3,6-dihydro-2H-pyridine has a molecular weight of 143.21 g/mol, XLogP of 1.95, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-fluoro-1-propan-2-yl-3,6-dihydro-2H-pyridine is sourced from PubChem (CID 127772956), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).