C15H19NO3 — CID 12777365
(2R,4aR,7aS)-2-(2-ethoxyphenyl)-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[e][1,3]oxazin-4-one (PubChem CID 12777365) has the molecular formula C15H19NO3 and a molecular weight of 261.32 g/mol. Its IUPAC name is (2R,4aR,7aS)-2-(2-ethoxyphenyl)-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[e][1,3]oxazin-4-one.
| Compound Name | (2R,4aR,7aS)-2-(2-ethoxyphenyl)-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[e][1,3]oxazin-4-one |
|---|---|
| PubChem CID | 12777365 |
| Molecular Formula | C15H19NO3 |
| Molecular Weight | 261.32 g/mol |
| Exact Mass | 261.14 |
| IUPAC Name | (2R,4aR,7aS)-2-(2-ethoxyphenyl)-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[e][1,3]oxazin-4-one |
| SMILES | CCOc1ccccc1[C@@H]1NC(=O)[C@@H]2CCC[C@@H]2O1 |
| InChI | InChI=1S/C15H19NO3/c1-2-18-12-8-4-3-6-11(12)15-16-14(17)10-7-5-9-13(10)19-15/h3-4,6,8,10,13,15H,2,5,7,9H2,1H3,(H,16,17)/t10-,13+,15-/m1/s1 |
| InChIKey | KNHBOLZPDVXZNY-RIEGTJTDSA-N |
| XLogP | 2.40 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.32 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |