About N-(1,2-dimethyl-6-oxopyrimidin-4-yl)-2-hydroxyacetamide
N-(1,2-dimethyl-6-oxopyrimidin-4-yl)-2-hydroxyacetamide (PubChem CID 12778123) has the molecular formula C8H11N3O3
and a molecular weight of 197.19 g/mol. Its IUPAC name is N-(1,2-dimethyl-6-oxopyrimidin-4-yl)-2-hydroxyacetamide.
Molecular Properties
| Compound Name | N-(1,2-dimethyl-6-oxopyrimidin-4-yl)-2-hydroxyacetamide |
| PubChem CID | 12778123 |
| Molecular Formula | C8H11N3O3 |
| Molecular Weight | 197.19 g/mol |
| Exact Mass | 197.08 |
| IUPAC Name | N-(1,2-dimethyl-6-oxopyrimidin-4-yl)-2-hydroxyacetamide |
| SMILES | Cc1nc(NC(=O)CO)cc(=O)n1C |
| InChI | InChI=1S/C8H11N3O3/c1-5-9-6(10-7(13)4-12)3-8(14)11(5)2/h3,12H,4H2,1-2H3,(H,10,13) |
| InChIKey | RWABLLAMMRKZKB-UHFFFAOYSA-N |
| XLogP | -0.98 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.19 |
| LogP ≤ 5 | -0.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-(1,2-dimethyl-6-oxopyrimidin-4-yl)-2-hydroxyacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(1,2-dimethyl-6-oxopyrimidin-4-yl)-2-hydroxyacetamide?
The IUPAC name of N-(1,2-dimethyl-6-oxopyrimidin-4-yl)-2-hydroxyacetamide (CID 12778123) is N-(1,2-dimethyl-6-oxopyrimidin-4-yl)-2-hydroxyacetamide.
What is the SMILES notation for N-(1,2-dimethyl-6-oxopyrimidin-4-yl)-2-hydroxyacetamide?
The canonical SMILES for N-(1,2-dimethyl-6-oxopyrimidin-4-yl)-2-hydroxyacetamide is Cc1nc(NC(=O)CO)cc(=O)n1C.
What is the InChIKey of N-(1,2-dimethyl-6-oxopyrimidin-4-yl)-2-hydroxyacetamide?
The InChIKey is RWABLLAMMRKZKB-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11N3O3/c1-5-9-6(10-7(13)4-12)3-8(14)11(5)2/h3,12H,4H2,1-2H3,(H,10,13).
What are the key properties of N-(1,2-dimethyl-6-oxopyrimidin-4-yl)-2-hydroxyacetamide?
N-(1,2-dimethyl-6-oxopyrimidin-4-yl)-2-hydroxyacetamide has a molecular weight of 197.19 g/mol, XLogP of -0.98, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-(1,2-dimethyl-6-oxopyrimidin-4-yl)-2-hydroxyacetamide is sourced from PubChem (CID 12778123), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).