C17H22ClNO7 — CID 12778184
(4S,14S)-19-chloro-4,14-dimethyl-3,6,9,12,15-pentaoxa-21-azabicyclo[15.3.1]henicosa-1(20),17(21),18-triene-2,16-dione (PubChem CID 12778184) has the molecular formula C17H22ClNO7 and a molecular weight of 387.82 g/mol. Its IUPAC name is (4S,14S)-19-chloro-4,14-dimethyl-3,6,9,12,15-pentaoxa-21-azabicyclo[15.3.1]henicosa-1(20),17(21),18-triene-2,16-dione.
| Compound Name | (4S,14S)-19-chloro-4,14-dimethyl-3,6,9,12,15-pentaoxa-21-azabicyclo[15.3.1]henicosa-1(20),17(21),18-triene-2,16-dione |
|---|---|
| PubChem CID | 12778184 |
| Molecular Formula | C17H22ClNO7 |
| Molecular Weight | 387.82 g/mol |
| Exact Mass | 387.11 |
| IUPAC Name | (4S,14S)-19-chloro-4,14-dimethyl-3,6,9,12,15-pentaoxa-21-azabicyclo[15.3.1]henicosa-1(20),17(21),18-triene-2,16-dione |
| SMILES | C[C@H]1COCCOCCOC[C@H](C)OC(=O)c2cc(Cl)cc(n2)C(=O)O1 |
| InChI | InChI=1S/C17H22ClNO7/c1-11-9-23-5-3-22-4-6-24-10-12(2)26-17(21)15-8-13(18)7-14(19-15)16(20)25-11/h7-8,11-12H,3-6,9-10H2,1-2H3/t11-,12-/m0/s1 |
| InChIKey | UEYNGSINFNWUIE-RYUDHWBXSA-N |
| XLogP | 1.89 |
| TPSA | 93.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.82 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |