C17H24N2O3S — CID 127784764
(5R,7R)-4-[(5-cyclopropyl-1,3-oxazol-2-yl)methyl]-10,10-dimethyl-3λ6-thia-4-azatricyclo[5.2.1.01,5]decane 3,3-dioxide (PubChem CID 127784764) has the molecular formula C17H24N2O3S and a molecular weight of 336.46 g/mol. Its IUPAC name is (5R,7R)-4-[(5-cyclopropyl-1,3-oxazol-2-yl)methyl]-10,10-dimethyl-3λ6-thia-4-azatricyclo[5.2.1.01,5]decane 3,3-dioxide.
| Compound Name | (5R,7R)-4-[(5-cyclopropyl-1,3-oxazol-2-yl)methyl]-10,10-dimethyl-3λ6-thia-4-azatricyclo[5.2.1.01,5]decane 3,3-dioxide |
|---|---|
| PubChem CID | 127784764 |
| Molecular Formula | C17H24N2O3S |
| Molecular Weight | 336.46 g/mol |
| Exact Mass | 336.15 |
| IUPAC Name | (5R,7R)-4-[(5-cyclopropyl-1,3-oxazol-2-yl)methyl]-10,10-dimethyl-3λ6-thia-4-azatricyclo[5.2.1.01,5]decane 3,3-dioxide |
| SMILES | CC1(C)[C@@H]2CCC13CS(=O)(=O)N(Cc1ncc(C4CC4)o1)[C@@H]3C2 |
| InChI | InChI=1S/C17H24N2O3S/c1-16(2)12-5-6-17(16)10-23(20,21)19(14(17)7-12)9-15-18-8-13(22-15)11-3-4-11/h8,11-12,14H,3-7,9-10H2,1-2H3/t12-,14-,17?/m1/s1 |
| InChIKey | XMSLLBATYINRBX-VDCCYECJSA-N |
| XLogP | 2.89 |
| TPSA | 63.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.46 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |