About 2-methyl-3,4-dihydro-2H-pyrrol-5-amine
2-methyl-3,4-dihydro-2H-pyrrol-5-amine (PubChem CID 12778906) has the molecular formula C5H10N2
and a molecular weight of 98.15 g/mol. Its IUPAC name is 2-methyl-3,4-dihydro-2H-pyrrol-5-amine.
Molecular Properties
| Compound Name | 2-methyl-3,4-dihydro-2H-pyrrol-5-amine |
| PubChem CID | 12778906 |
| Molecular Formula | C5H10N2 |
| Molecular Weight | 98.15 g/mol |
| Exact Mass | 98.08 |
| IUPAC Name | 2-methyl-3,4-dihydro-2H-pyrrol-5-amine |
| SMILES | CC1CCC(N)=N1 |
| InChI | InChI=1S/C5H10N2/c1-4-2-3-5(6)7-4/h4H,2-3H2,1H3,(H2,6,7) |
| InChIKey | DDQFWSHGBVMBEM-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 98.15 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-methyl-3,4-dihydro-2H-pyrrol-5-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-3,4-dihydro-2H-pyrrol-5-amine?
The IUPAC name of 2-methyl-3,4-dihydro-2H-pyrrol-5-amine (CID 12778906) is 2-methyl-3,4-dihydro-2H-pyrrol-5-amine.
What is the SMILES notation for 2-methyl-3,4-dihydro-2H-pyrrol-5-amine?
The canonical SMILES for 2-methyl-3,4-dihydro-2H-pyrrol-5-amine is CC1CCC(N)=N1.
What is the InChIKey of 2-methyl-3,4-dihydro-2H-pyrrol-5-amine?
The InChIKey is DDQFWSHGBVMBEM-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H10N2/c1-4-2-3-5(6)7-4/h4H,2-3H2,1H3,(H2,6,7).
What are the key properties of 2-methyl-3,4-dihydro-2H-pyrrol-5-amine?
2-methyl-3,4-dihydro-2H-pyrrol-5-amine has a molecular weight of 98.15 g/mol, XLogP of 0.53, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-3,4-dihydro-2H-pyrrol-5-amine is sourced from PubChem (CID 12778906), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).