C6H12N2 — CID 12778908
2-methyl-2,3,4,5-tetrahydropyridin-6-amine (PubChem CID 12778908) has the molecular formula C6H12N2 and a molecular weight of 112.18 g/mol. Its IUPAC name is 2-methyl-2,3,4,5-tetrahydropyridin-6-amine.
| Compound Name | 2-methyl-2,3,4,5-tetrahydropyridin-6-amine |
|---|---|
| PubChem CID | 12778908 |
| Molecular Formula | C6H12N2 |
| Molecular Weight | 112.18 g/mol |
| Exact Mass | 112.10 |
| IUPAC Name | 2-methyl-2,3,4,5-tetrahydropyridin-6-amine |
| SMILES | CC1CCCC(N)=N1 |
| InChI | InChI=1S/C6H12N2/c1-5-3-2-4-6(7)8-5/h5H,2-4H2,1H3,(H2,7,8) |
| InChIKey | UTJJCBMDCZDYKT-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 112.18 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |