About 4,8-diphenylazulene
4,8-diphenylazulene (PubChem CID 12779623) has the molecular formula C22H16
and a molecular weight of 280.37 g/mol. Its IUPAC name is 4,8-diphenylazulene.
Molecular Properties
| Compound Name | 4,8-diphenylazulene |
| PubChem CID | 12779623 |
| Molecular Formula | C22H16 |
| Molecular Weight | 280.37 g/mol |
| Exact Mass | 280.13 |
| IUPAC Name | 4,8-diphenylazulene |
| SMILES | c1ccc(-c2cccc(-c3ccccc3)c3cccc2-3)cc1 |
| InChI | InChI=1S/C22H16/c1-3-9-17(10-4-1)19-13-7-14-20(18-11-5-2-6-12-18)22-16-8-15-21(19)22/h1-16H |
| InChIKey | VXAIEHZGSFJIHG-UHFFFAOYSA-N |
| XLogP | 6.13 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 280.37 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 4,8-diphenylazulene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,8-diphenylazulene?
The IUPAC name of 4,8-diphenylazulene (CID 12779623) is 4,8-diphenylazulene.
What is the SMILES notation for 4,8-diphenylazulene?
The canonical SMILES for 4,8-diphenylazulene is c1ccc(-c2cccc(-c3ccccc3)c3cccc2-3)cc1.
What is the InChIKey of 4,8-diphenylazulene?
The InChIKey is VXAIEHZGSFJIHG-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H16/c1-3-9-17(10-4-1)19-13-7-14-20(18-11-5-2-6-12-18)22-16-8-15-21(19)22/h1-16H.
What are the key properties of 4,8-diphenylazulene?
4,8-diphenylazulene has a molecular weight of 280.37 g/mol, XLogP of 6.13, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 4,8-diphenylazulene is sourced from PubChem (CID 12779623), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).