About N,N-diethyl-4-methylpenta-1,2,3-trien-1-amine
N,N-diethyl-4-methylpenta-1,2,3-trien-1-amine (PubChem CID 12779717) has the molecular formula C10H17N
and a molecular weight of 151.25 g/mol. Its IUPAC name is N,N-diethyl-4-methylpenta-1,2,3-trien-1-amine.
Molecular Properties
| Compound Name | N,N-diethyl-4-methylpenta-1,2,3-trien-1-amine |
| PubChem CID | 12779717 |
| Molecular Formula | C10H17N |
| Molecular Weight | 151.25 g/mol |
| Exact Mass | 151.14 |
| IUPAC Name | N,N-diethyl-4-methylpenta-1,2,3-trien-1-amine |
| SMILES | CCN(C=C=C=C(C)C)CC |
| InChI | InChI=1S/C10H17N/c1-5-11(6-2)9-7-8-10(3)4/h9H,5-6H2,1-4H3 |
| InChIKey | MPSSCFNFOBYZAX-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 151.25 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze N,N-diethyl-4-methylpenta-1,2,3-trien-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-diethyl-4-methylpenta-1,2,3-trien-1-amine?
The IUPAC name of N,N-diethyl-4-methylpenta-1,2,3-trien-1-amine (CID 12779717) is N,N-diethyl-4-methylpenta-1,2,3-trien-1-amine.
What is the SMILES notation for N,N-diethyl-4-methylpenta-1,2,3-trien-1-amine?
The canonical SMILES for N,N-diethyl-4-methylpenta-1,2,3-trien-1-amine is CCN(C=C=C=C(C)C)CC.
What is the InChIKey of N,N-diethyl-4-methylpenta-1,2,3-trien-1-amine?
The InChIKey is MPSSCFNFOBYZAX-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H17N/c1-5-11(6-2)9-7-8-10(3)4/h9H,5-6H2,1-4H3.
What are the key properties of N,N-diethyl-4-methylpenta-1,2,3-trien-1-amine?
N,N-diethyl-4-methylpenta-1,2,3-trien-1-amine has a molecular weight of 151.25 g/mol, XLogP of 2.56, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-diethyl-4-methylpenta-1,2,3-trien-1-amine is sourced from PubChem (CID 12779717), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).