About N-(4,4-dicyclohexylbutyl)cyclohexanamine;hydrochloride
N-(4,4-dicyclohexylbutyl)cyclohexanamine;hydrochloride (PubChem CID 12779967) has the molecular formula C22H42ClN
and a molecular weight of 356.04 g/mol. Its IUPAC name is N-(4,4-dicyclohexylbutyl)cyclohexanamine;hydrochloride.
Molecular Properties
| Compound Name | N-(4,4-dicyclohexylbutyl)cyclohexanamine;hydrochloride |
| PubChem CID | 12779967 |
| Molecular Formula | C22H42ClN |
| Molecular Weight | 356.04 g/mol |
| Exact Mass | 355.30 |
| IUPAC Name | N-(4,4-dicyclohexylbutyl)cyclohexanamine;hydrochloride |
| SMILES | C1CCC(NCCCC(C2CCCCC2)C2CCCCC2)CC1.Cl |
| InChI | InChI=1S/C22H41N.ClH/c1-4-11-19(12-5-1)22(20-13-6-2-7-14-20)17-10-18-23-21-15-8-3-9-16-21;/h19-23H,1-18H2;1H |
| InChIKey | BFVXGIPHLTWAHX-UHFFFAOYSA-N |
| XLogP | 6.89 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 356.04 |
| LogP ≤ 5 | 6.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-(4,4-dicyclohexylbutyl)cyclohexanamine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(4,4-dicyclohexylbutyl)cyclohexanamine;hydrochloride?
The IUPAC name of N-(4,4-dicyclohexylbutyl)cyclohexanamine;hydrochloride (CID 12779967) is N-(4,4-dicyclohexylbutyl)cyclohexanamine;hydrochloride.
What is the SMILES notation for N-(4,4-dicyclohexylbutyl)cyclohexanamine;hydrochloride?
The canonical SMILES for N-(4,4-dicyclohexylbutyl)cyclohexanamine;hydrochloride is C1CCC(NCCCC(C2CCCCC2)C2CCCCC2)CC1.Cl.
What is the InChIKey of N-(4,4-dicyclohexylbutyl)cyclohexanamine;hydrochloride?
The InChIKey is BFVXGIPHLTWAHX-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H41N.ClH/c1-4-11-19(12-5-1)22(20-13-6-2-7-14-20)17-10-18-23-21-15-8-3-9-16-21;/h19-23H,1-18H2;1H.
What are the key properties of N-(4,4-dicyclohexylbutyl)cyclohexanamine;hydrochloride?
N-(4,4-dicyclohexylbutyl)cyclohexanamine;hydrochloride has a molecular weight of 356.04 g/mol, XLogP of 6.89, 7 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-(4,4-dicyclohexylbutyl)cyclohexanamine;hydrochloride is sourced from PubChem (CID 12779967), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).