About 3-phenyl-1H-isoindole
3-phenyl-1H-isoindole (PubChem CID 12780483) has the molecular formula C14H11N
and a molecular weight of 193.25 g/mol. Its IUPAC name is 3-phenyl-1H-isoindole.
Molecular Properties
| Compound Name | 3-phenyl-1H-isoindole |
| PubChem CID | 12780483 |
| Molecular Formula | C14H11N |
| Molecular Weight | 193.25 g/mol |
| Exact Mass | 193.09 |
| IUPAC Name | 3-phenyl-1H-isoindole |
| SMILES | c1ccc(C2=NCc3ccccc32)cc1 |
| InChI | InChI=1S/C14H11N/c1-2-6-11(7-3-1)14-13-9-5-4-8-12(13)10-15-14/h1-9H,10H2 |
| InChIKey | UEELVSDELRPFOH-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 193.25 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3-phenyl-1H-isoindole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-phenyl-1H-isoindole?
The IUPAC name of 3-phenyl-1H-isoindole (CID 12780483) is 3-phenyl-1H-isoindole.
What is the SMILES notation for 3-phenyl-1H-isoindole?
The canonical SMILES for 3-phenyl-1H-isoindole is c1ccc(C2=NCc3ccccc32)cc1.
What is the InChIKey of 3-phenyl-1H-isoindole?
The InChIKey is UEELVSDELRPFOH-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H11N/c1-2-6-11(7-3-1)14-13-9-5-4-8-12(13)10-15-14/h1-9H,10H2.
What are the key properties of 3-phenyl-1H-isoindole?
3-phenyl-1H-isoindole has a molecular weight of 193.25 g/mol, XLogP of 3.04, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-phenyl-1H-isoindole is sourced from PubChem (CID 12780483), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).