About 6-bromo-1-[(1,3,5-trimethylpyrazol-4-yl)iminomethyl]naphthalen-2-ol
6-bromo-1-[(1,3,5-trimethylpyrazol-4-yl)iminomethyl]naphthalen-2-ol (PubChem CID 1278069) has the molecular formula C17H16BrN3O
and a molecular weight of 358.24 g/mol. Its IUPAC name is 6-bromo-1-[(1,3,5-trimethylpyrazol-4-yl)iminomethyl]naphthalen-2-ol.
Molecular Properties
| Compound Name | 6-bromo-1-[(1,3,5-trimethylpyrazol-4-yl)iminomethyl]naphthalen-2-ol |
| PubChem CID | 1278069 |
| Molecular Formula | C17H16BrN3O |
| Molecular Weight | 358.24 g/mol |
| Exact Mass | 357.05 |
| IUPAC Name | 6-bromo-1-[(1,3,5-trimethylpyrazol-4-yl)iminomethyl]naphthalen-2-ol |
| SMILES | Cc1nn(C)c(C)c1/N=C/c1c(O)ccc2cc(Br)ccc12 |
| InChI | InChI=1S/C17H16BrN3O/c1-10-17(11(2)21(3)20-10)19-9-15-14-6-5-13(18)8-12(14)4-7-16(15)22/h4-9,22H,1-3H3/b19-9+ |
| InChIKey | NJEPEOXMUWBMBA-DJKKODMXSA-N |
| XLogP | 4.41 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 358.24 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 6-bromo-1-[(1,3,5-trimethylpyrazol-4-yl)iminomethyl]naphthalen-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-bromo-1-[(1,3,5-trimethylpyrazol-4-yl)iminomethyl]naphthalen-2-ol?
The IUPAC name of 6-bromo-1-[(1,3,5-trimethylpyrazol-4-yl)iminomethyl]naphthalen-2-ol (CID 1278069) is 6-bromo-1-[(1,3,5-trimethylpyrazol-4-yl)iminomethyl]naphthalen-2-ol.
What is the SMILES notation for 6-bromo-1-[(1,3,5-trimethylpyrazol-4-yl)iminomethyl]naphthalen-2-ol?
The canonical SMILES for 6-bromo-1-[(1,3,5-trimethylpyrazol-4-yl)iminomethyl]naphthalen-2-ol is Cc1nn(C)c(C)c1/N=C/c1c(O)ccc2cc(Br)ccc12.
What is the InChIKey of 6-bromo-1-[(1,3,5-trimethylpyrazol-4-yl)iminomethyl]naphthalen-2-ol?
The InChIKey is NJEPEOXMUWBMBA-DJKKODMXSA-N. The full InChI is InChI=1S/C17H16BrN3O/c1-10-17(11(2)21(3)20-10)19-9-15-14-6-5-13(18)8-12(14)4-7-16(15)22/h4-9,22H,1-3H3/b19-9+.
What are the key properties of 6-bromo-1-[(1,3,5-trimethylpyrazol-4-yl)iminomethyl]naphthalen-2-ol?
6-bromo-1-[(1,3,5-trimethylpyrazol-4-yl)iminomethyl]naphthalen-2-ol has a molecular weight of 358.24 g/mol, XLogP of 4.41, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-bromo-1-[(1,3,5-trimethylpyrazol-4-yl)iminomethyl]naphthalen-2-ol is sourced from PubChem (CID 1278069), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).