About 2-(2-nitroethenyl)furan
2-(2-nitroethenyl)furan (PubChem CID 12781) has the molecular formula C6H5NO3
and a molecular weight of 139.11 g/mol. Its IUPAC name is 2-(2-nitroethenyl)furan.
Molecular Properties
| Compound Name | 2-(2-nitroethenyl)furan |
| PubChem CID | 12781 |
| Molecular Formula | C6H5NO3 |
| Molecular Weight | 139.11 g/mol |
| Exact Mass | 139.03 |
| IUPAC Name | 2-(2-nitroethenyl)furan |
| SMILES | O=[N+]([O-])C=Cc1ccco1 |
| InChI | InChI=1S/C6H5NO3/c8-7(9)4-3-6-2-1-5-10-6/h1-5H |
| InChIKey | WVUICGOYGDHVBH-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 56.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 139.11 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-(2-nitroethenyl)furan with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-nitroethenyl)furan?
The IUPAC name of 2-(2-nitroethenyl)furan (CID 12781) is 2-(2-nitroethenyl)furan.
What is the SMILES notation for 2-(2-nitroethenyl)furan?
The canonical SMILES for 2-(2-nitroethenyl)furan is O=[N+]([O-])C=Cc1ccco1.
What is the InChIKey of 2-(2-nitroethenyl)furan?
The InChIKey is WVUICGOYGDHVBH-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H5NO3/c8-7(9)4-3-6-2-1-5-10-6/h1-5H.
What are the key properties of 2-(2-nitroethenyl)furan?
2-(2-nitroethenyl)furan has a molecular weight of 139.11 g/mol, XLogP of 1.53, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-nitroethenyl)furan is sourced from PubChem (CID 12781), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).