About [4-(1,3-dithiolan-2-yl)phenyl] 3-(trifluoromethyl)benzoate
[4-(1,3-dithiolan-2-yl)phenyl] 3-(trifluoromethyl)benzoate (PubChem CID 1278123) has the molecular formula C17H13F3O2S2
and a molecular weight of 370.42 g/mol. Its IUPAC name is [4-(1,3-dithiolan-2-yl)phenyl] 3-(trifluoromethyl)benzoate.
Molecular Properties
| Compound Name | [4-(1,3-dithiolan-2-yl)phenyl] 3-(trifluoromethyl)benzoate |
| PubChem CID | 1278123 |
| Molecular Formula | C17H13F3O2S2 |
| Molecular Weight | 370.42 g/mol |
| Exact Mass | 370.03 |
| IUPAC Name | [4-(1,3-dithiolan-2-yl)phenyl] 3-(trifluoromethyl)benzoate |
| SMILES | O=C(Oc1ccc(C2SCCS2)cc1)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C17H13F3O2S2/c18-17(19,20)13-3-1-2-12(10-13)15(21)22-14-6-4-11(5-7-14)16-23-8-9-24-16/h1-7,10,16H,8-9H2 |
| InChIKey | IACZGDJFKBXKTC-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 370.42 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze [4-(1,3-dithiolan-2-yl)phenyl] 3-(trifluoromethyl)benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-(1,3-dithiolan-2-yl)phenyl] 3-(trifluoromethyl)benzoate?
The IUPAC name of [4-(1,3-dithiolan-2-yl)phenyl] 3-(trifluoromethyl)benzoate (CID 1278123) is [4-(1,3-dithiolan-2-yl)phenyl] 3-(trifluoromethyl)benzoate.
What is the SMILES notation for [4-(1,3-dithiolan-2-yl)phenyl] 3-(trifluoromethyl)benzoate?
The canonical SMILES for [4-(1,3-dithiolan-2-yl)phenyl] 3-(trifluoromethyl)benzoate is O=C(Oc1ccc(C2SCCS2)cc1)c1cccc(C(F)(F)F)c1.
What is the InChIKey of [4-(1,3-dithiolan-2-yl)phenyl] 3-(trifluoromethyl)benzoate?
The InChIKey is IACZGDJFKBXKTC-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H13F3O2S2/c18-17(19,20)13-3-1-2-12(10-13)15(21)22-14-6-4-11(5-7-14)16-23-8-9-24-16/h1-7,10,16H,8-9H2.
What are the key properties of [4-(1,3-dithiolan-2-yl)phenyl] 3-(trifluoromethyl)benzoate?
[4-(1,3-dithiolan-2-yl)phenyl] 3-(trifluoromethyl)benzoate has a molecular weight of 370.42 g/mol, XLogP of 5.40, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [4-(1,3-dithiolan-2-yl)phenyl] 3-(trifluoromethyl)benzoate is sourced from PubChem (CID 1278123), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).