About 2-chloro-1,3,2-benzodithiaphosphole
2-chloro-1,3,2-benzodithiaphosphole (PubChem CID 12781637) has the molecular formula C6H4ClPS2
and a molecular weight of 206.66 g/mol. Its IUPAC name is 2-chloro-1,3,2-benzodithiaphosphole.
Molecular Properties
| Compound Name | 2-chloro-1,3,2-benzodithiaphosphole |
| PubChem CID | 12781637 |
| Molecular Formula | C6H4ClPS2 |
| Molecular Weight | 206.66 g/mol |
| Exact Mass | 205.92 |
| IUPAC Name | 2-chloro-1,3,2-benzodithiaphosphole |
| SMILES | ClP1Sc2ccccc2S1 |
| InChI | InChI=1S/C6H4ClPS2/c7-8-9-5-3-1-2-4-6(5)10-8/h1-4H |
| InChIKey | QVXOYKCPLXEMNL-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.66 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 2-chloro-1,3,2-benzodithiaphosphole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-1,3,2-benzodithiaphosphole?
The IUPAC name of 2-chloro-1,3,2-benzodithiaphosphole (CID 12781637) is 2-chloro-1,3,2-benzodithiaphosphole.
What is the SMILES notation for 2-chloro-1,3,2-benzodithiaphosphole?
The canonical SMILES for 2-chloro-1,3,2-benzodithiaphosphole is ClP1Sc2ccccc2S1.
What is the InChIKey of 2-chloro-1,3,2-benzodithiaphosphole?
The InChIKey is QVXOYKCPLXEMNL-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H4ClPS2/c7-8-9-5-3-1-2-4-6(5)10-8/h1-4H.
What are the key properties of 2-chloro-1,3,2-benzodithiaphosphole?
2-chloro-1,3,2-benzodithiaphosphole has a molecular weight of 206.66 g/mol, XLogP of 4.35, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-1,3,2-benzodithiaphosphole is sourced from PubChem (CID 12781637), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).