About methyl 5-methyl-2-oxo-1,3-oxazolidine-4-carboxylate
methyl 5-methyl-2-oxo-1,3-oxazolidine-4-carboxylate (PubChem CID 12781789) has the molecular formula C6H9NO4
and a molecular weight of 159.14 g/mol. Its IUPAC name is methyl 5-methyl-2-oxo-1,3-oxazolidine-4-carboxylate.
Molecular Properties
| Compound Name | methyl 5-methyl-2-oxo-1,3-oxazolidine-4-carboxylate |
| PubChem CID | 12781789 |
| Molecular Formula | C6H9NO4 |
| Molecular Weight | 159.14 g/mol |
| Exact Mass | 159.05 |
| IUPAC Name | methyl 5-methyl-2-oxo-1,3-oxazolidine-4-carboxylate |
| SMILES | COC(=O)C1NC(=O)OC1C |
| InChI | InChI=1S/C6H9NO4/c1-3-4(5(8)10-2)7-6(9)11-3/h3-4H,1-2H3,(H,7,9) |
| InChIKey | ZFMPPJBWITWSDQ-UHFFFAOYSA-N |
| XLogP | -0.34 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 159.14 |
| LogP ≤ 5 | -0.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze methyl 5-methyl-2-oxo-1,3-oxazolidine-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 5-methyl-2-oxo-1,3-oxazolidine-4-carboxylate?
The IUPAC name of methyl 5-methyl-2-oxo-1,3-oxazolidine-4-carboxylate (CID 12781789) is methyl 5-methyl-2-oxo-1,3-oxazolidine-4-carboxylate.
What is the SMILES notation for methyl 5-methyl-2-oxo-1,3-oxazolidine-4-carboxylate?
The canonical SMILES for methyl 5-methyl-2-oxo-1,3-oxazolidine-4-carboxylate is COC(=O)C1NC(=O)OC1C.
What is the InChIKey of methyl 5-methyl-2-oxo-1,3-oxazolidine-4-carboxylate?
The InChIKey is ZFMPPJBWITWSDQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H9NO4/c1-3-4(5(8)10-2)7-6(9)11-3/h3-4H,1-2H3,(H,7,9).
What are the key properties of methyl 5-methyl-2-oxo-1,3-oxazolidine-4-carboxylate?
methyl 5-methyl-2-oxo-1,3-oxazolidine-4-carboxylate has a molecular weight of 159.14 g/mol, XLogP of -0.34, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 5-methyl-2-oxo-1,3-oxazolidine-4-carboxylate is sourced from PubChem (CID 12781789), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).