C12H36O12P4Si4 — CID 12781802
bis(trimethylsilyl) [2,4,6-trioxo-4,6-bis(trimethylsilyloxy)-1,3,5,2λ5,4λ5,6λ5-trioxatriphosphinan-2-yl] phosphate (PubChem CID 12781802) has the molecular formula C12H36O12P4Si4 and a molecular weight of 608.65 g/mol. Its IUPAC name is bis(trimethylsilyl) [2,4,6-trioxo-4,6-bis(trimethylsilyloxy)-1,3,5,2λ5,4λ5,6λ5-trioxatriphosphinan-2-yl] phosphate.
| Compound Name | bis(trimethylsilyl) [2,4,6-trioxo-4,6-bis(trimethylsilyloxy)-1,3,5,2λ5,4λ5,6λ5-trioxatriphosphinan-2-yl] phosphate |
|---|---|
| PubChem CID | 12781802 |
| Molecular Formula | C12H36O12P4Si4 |
| Molecular Weight | 608.65 g/mol |
| Exact Mass | 608.02 |
| IUPAC Name | bis(trimethylsilyl) [2,4,6-trioxo-4,6-bis(trimethylsilyloxy)-1,3,5,2λ5,4λ5,6λ5-trioxatriphosphinan-2-yl] phosphate |
| SMILES | C[Si](C)(C)OP(=O)(O[Si](C)(C)C)OP1(=O)OP(=O)(O[Si](C)(C)C)OP(=O)(O[Si](C)(C)C)O1 |
| InChI | InChI=1S/C12H36O12P4Si4/c1-29(2,3)21-26(14)17-25(13,18-27(15,20-26)22-30(4,5)6)19-28(16,23-31(7,8)9)24-32(10,11)12/h1-12H3 |
| InChIKey | GLDHDIGHLPPUAO-UHFFFAOYSA-N |
| XLogP | 7.90 |
| TPSA | 142.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.65 |
| LogP ≤ 5 | 7.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|