About 7-chloro-5-isothiocyanato-2-thiophen-2-yl-1,3-benzoxazole
7-chloro-5-isothiocyanato-2-thiophen-2-yl-1,3-benzoxazole (PubChem CID 12781919) has the molecular formula C12H5ClN2OS2
and a molecular weight of 292.77 g/mol. Its IUPAC name is 7-chloro-5-isothiocyanato-2-thiophen-2-yl-1,3-benzoxazole.
Molecular Properties
| Compound Name | 7-chloro-5-isothiocyanato-2-thiophen-2-yl-1,3-benzoxazole |
| PubChem CID | 12781919 |
| Molecular Formula | C12H5ClN2OS2 |
| Molecular Weight | 292.77 g/mol |
| Exact Mass | 291.95 |
| IUPAC Name | 7-chloro-5-isothiocyanato-2-thiophen-2-yl-1,3-benzoxazole |
| SMILES | S=C=Nc1cc(Cl)c2oc(-c3cccs3)nc2c1 |
| InChI | InChI=1S/C12H5ClN2OS2/c13-8-4-7(14-6-17)5-9-11(8)16-12(15-9)10-2-1-3-18-10/h1-5H |
| InChIKey | ILFKTBRZPMPQAK-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 38.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 292.77 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 7-chloro-5-isothiocyanato-2-thiophen-2-yl-1,3-benzoxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-chloro-5-isothiocyanato-2-thiophen-2-yl-1,3-benzoxazole?
The IUPAC name of 7-chloro-5-isothiocyanato-2-thiophen-2-yl-1,3-benzoxazole (CID 12781919) is 7-chloro-5-isothiocyanato-2-thiophen-2-yl-1,3-benzoxazole.
What is the SMILES notation for 7-chloro-5-isothiocyanato-2-thiophen-2-yl-1,3-benzoxazole?
The canonical SMILES for 7-chloro-5-isothiocyanato-2-thiophen-2-yl-1,3-benzoxazole is S=C=Nc1cc(Cl)c2oc(-c3cccs3)nc2c1.
What is the InChIKey of 7-chloro-5-isothiocyanato-2-thiophen-2-yl-1,3-benzoxazole?
The InChIKey is ILFKTBRZPMPQAK-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H5ClN2OS2/c13-8-4-7(14-6-17)5-9-11(8)16-12(15-9)10-2-1-3-18-10/h1-5H.
What are the key properties of 7-chloro-5-isothiocyanato-2-thiophen-2-yl-1,3-benzoxazole?
7-chloro-5-isothiocyanato-2-thiophen-2-yl-1,3-benzoxazole has a molecular weight of 292.77 g/mol, XLogP of 4.94, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 7-chloro-5-isothiocyanato-2-thiophen-2-yl-1,3-benzoxazole is sourced from PubChem (CID 12781919), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).