About 1,3-dimethyl-4,5-dihydroimidazol-1-ium-2-carbodithioic acid
1,3-dimethyl-4,5-dihydroimidazol-1-ium-2-carbodithioic acid (PubChem CID 12782484) has the molecular formula C6H11N2S2+
and a molecular weight of 175.30 g/mol. Its IUPAC name is 1,3-dimethyl-4,5-dihydroimidazol-1-ium-2-carbodithioic acid.
Molecular Properties
| Compound Name | 1,3-dimethyl-4,5-dihydroimidazol-1-ium-2-carbodithioic acid |
| PubChem CID | 12782484 |
| Molecular Formula | C6H11N2S2+ |
| Molecular Weight | 175.30 g/mol |
| Exact Mass | 175.04 |
| IUPAC Name | 1,3-dimethyl-4,5-dihydroimidazol-1-ium-2-carbodithioic acid |
| SMILES | CN1CC[N+](C)=C1C(=S)S |
| InChI | InChI=1S/C6H10N2S2/c1-7-3-4-8(2)5(7)6(9)10/h3-4H2,1-2H3/p+1 |
| InChIKey | QYHMEWBFHOOAHY-UHFFFAOYSA-O |
| XLogP | 0.23 |
| TPSA | 6.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 175.30 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 1,3-dimethyl-4,5-dihydroimidazol-1-ium-2-carbodithioic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3-dimethyl-4,5-dihydroimidazol-1-ium-2-carbodithioic acid?
The IUPAC name of 1,3-dimethyl-4,5-dihydroimidazol-1-ium-2-carbodithioic acid (CID 12782484) is 1,3-dimethyl-4,5-dihydroimidazol-1-ium-2-carbodithioic acid.
What is the SMILES notation for 1,3-dimethyl-4,5-dihydroimidazol-1-ium-2-carbodithioic acid?
The canonical SMILES for 1,3-dimethyl-4,5-dihydroimidazol-1-ium-2-carbodithioic acid is CN1CC[N+](C)=C1C(=S)S.
What is the InChIKey of 1,3-dimethyl-4,5-dihydroimidazol-1-ium-2-carbodithioic acid?
The InChIKey is QYHMEWBFHOOAHY-UHFFFAOYSA-O. The full InChI is InChI=1S/C6H10N2S2/c1-7-3-4-8(2)5(7)6(9)10/h3-4H2,1-2H3/p+1.
What are the key properties of 1,3-dimethyl-4,5-dihydroimidazol-1-ium-2-carbodithioic acid?
1,3-dimethyl-4,5-dihydroimidazol-1-ium-2-carbodithioic acid has a molecular weight of 175.30 g/mol, XLogP of 0.23, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3-dimethyl-4,5-dihydroimidazol-1-ium-2-carbodithioic acid is sourced from PubChem (CID 12782484), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).