C22H27N3OS — CID 1278258
N-(2,2,6,6-tetramethylpiperidin-4-yl)phenothiazine-10-carboxamide (PubChem CID 1278258) has the molecular formula C22H27N3OS and a molecular weight of 381.55 g/mol. Its IUPAC name is N-(2,2,6,6-tetramethylpiperidin-4-yl)phenothiazine-10-carboxamide.
| Compound Name | N-(2,2,6,6-tetramethylpiperidin-4-yl)phenothiazine-10-carboxamide |
|---|---|
| PubChem CID | 1278258 |
| Molecular Formula | C22H27N3OS |
| Molecular Weight | 381.55 g/mol |
| Exact Mass | 381.19 |
| IUPAC Name | N-(2,2,6,6-tetramethylpiperidin-4-yl)phenothiazine-10-carboxamide |
| SMILES | CC1(C)CC(NC(=O)N2c3ccccc3Sc3ccccc32)CC(C)(C)N1 |
| InChI | InChI=1S/C22H27N3OS/c1-21(2)13-15(14-22(3,4)24-21)23-20(26)25-16-9-5-7-11-18(16)27-19-12-8-6-10-17(19)25/h5-12,15,24H,13-14H2,1-4H3,(H,23,26) |
| InChIKey | YHHSUMUYBDRSMV-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.55 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |