About 4-phenyl-[1,3]thiazino[3,2-a]benzimidazol-2-imine
4-phenyl-[1,3]thiazino[3,2-a]benzimidazol-2-imine (PubChem CID 12782582) has the molecular formula C16H11N3S
and a molecular weight of 277.35 g/mol. Its IUPAC name is 4-phenyl-[1,3]thiazino[3,2-a]benzimidazol-2-imine.
Molecular Properties
| Compound Name | 4-phenyl-[1,3]thiazino[3,2-a]benzimidazol-2-imine |
| PubChem CID | 12782582 |
| Molecular Formula | C16H11N3S |
| Molecular Weight | 277.35 g/mol |
| Exact Mass | 277.07 |
| IUPAC Name | 4-phenyl-[1,3]thiazino[3,2-a]benzimidazol-2-imine |
| SMILES | [H]/N=c1/cc(-c2ccccc2)n2c(nc3ccccc32)s1 |
| InChI | InChI=1S/C16H11N3S/c17-15-10-14(11-6-2-1-3-7-11)19-13-9-5-4-8-12(13)18-16(19)20-15/h1-10,17H/b17-15- |
| InChIKey | YFAFKXNKHOYWTP-ICFOKQHNSA-N |
| XLogP | 3.70 |
| TPSA | 41.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 277.35 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-phenyl-[1,3]thiazino[3,2-a]benzimidazol-2-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-phenyl-[1,3]thiazino[3,2-a]benzimidazol-2-imine?
The IUPAC name of 4-phenyl-[1,3]thiazino[3,2-a]benzimidazol-2-imine (CID 12782582) is 4-phenyl-[1,3]thiazino[3,2-a]benzimidazol-2-imine.
What is the SMILES notation for 4-phenyl-[1,3]thiazino[3,2-a]benzimidazol-2-imine?
The canonical SMILES for 4-phenyl-[1,3]thiazino[3,2-a]benzimidazol-2-imine is [H]/N=c1/cc(-c2ccccc2)n2c(nc3ccccc32)s1.
What is the InChIKey of 4-phenyl-[1,3]thiazino[3,2-a]benzimidazol-2-imine?
The InChIKey is YFAFKXNKHOYWTP-ICFOKQHNSA-N. The full InChI is InChI=1S/C16H11N3S/c17-15-10-14(11-6-2-1-3-7-11)19-13-9-5-4-8-12(13)18-16(19)20-15/h1-10,17H/b17-15-.
What are the key properties of 4-phenyl-[1,3]thiazino[3,2-a]benzimidazol-2-imine?
4-phenyl-[1,3]thiazino[3,2-a]benzimidazol-2-imine has a molecular weight of 277.35 g/mol, XLogP of 3.70, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-phenyl-[1,3]thiazino[3,2-a]benzimidazol-2-imine is sourced from PubChem (CID 12782582), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).