C18H17F3N4OS — CID 12783575
(E)-N,N-diethyl-3-[6-phenyl-2-(trifluoromethyl)imidazo[2,1-b][1,3,4]thiadiazol-5-yl]prop-2-enamide (PubChem CID 12783575) has the molecular formula C18H17F3N4OS and a molecular weight of 394.42 g/mol. Its IUPAC name is (E)-N,N-diethyl-3-[6-phenyl-2-(trifluoromethyl)imidazo[2,1-b][1,3,4]thiadiazol-5-yl]prop-2-enamide.
| Compound Name | (E)-N,N-diethyl-3-[6-phenyl-2-(trifluoromethyl)imidazo[2,1-b][1,3,4]thiadiazol-5-yl]prop-2-enamide |
|---|---|
| PubChem CID | 12783575 |
| Molecular Formula | C18H17F3N4OS |
| Molecular Weight | 394.42 g/mol |
| Exact Mass | 394.11 |
| IUPAC Name | (E)-N,N-diethyl-3-[6-phenyl-2-(trifluoromethyl)imidazo[2,1-b][1,3,4]thiadiazol-5-yl]prop-2-enamide |
| SMILES | CCN(CC)C(=O)/C=C/c1c(-c2ccccc2)nc2sc(C(F)(F)F)nn12 |
| InChI | InChI=1S/C18H17F3N4OS/c1-3-24(4-2)14(26)11-10-13-15(12-8-6-5-7-9-12)22-17-25(13)23-16(27-17)18(19,20)21/h5-11H,3-4H2,1-2H3/b11-10+ |
| InChIKey | SDRSKSKZBXKYGG-ZHACJKMWSA-N |
| XLogP | 4.36 |
| TPSA | 50.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.42 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|