C11H16 — CID 12784
1,2,3,4,5-pentamethylbenzene (PubChem CID 12784) has the molecular formula C11H16 and a molecular weight of 148.25 g/mol. Its IUPAC name is 1,2,3,4,5-pentamethylbenzene.
| Compound Name | 1,2,3,4,5-pentamethylbenzene |
|---|---|
| PubChem CID | 12784 |
| Molecular Formula | C11H16 |
| Molecular Weight | 148.25 g/mol |
| Exact Mass | 148.13 |
| IUPAC Name | 1,2,3,4,5-pentamethylbenzene |
| SMILES | Cc1cc(C)c(C)c(C)c1C |
| InChI | InChI=1S/C11H16/c1-7-6-8(2)10(4)11(5)9(7)3/h6H,1-5H3 |
| InChIKey | BEZDDPMMPIDMGJ-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 148.25 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |