2-[2-fluoro-4-(1,3-thiazol-2-yloxy)phenyl]propanoic acid

C12H10FNO3S — CID 12785124

IUPAC2-[2-fluoro-4-(1,3-thiazol-2-yloxy)phenyl]propanoic acid
SMILESCC(C(=O)O)c1ccc(Oc2nccs2)cc1F
InChIInChI=1S/C12H10FNO3S/c1-7(11(15)16)9-3-2-8(6-10(9)13)17-12-14-4-5-18-12/h2-7H,1H3,(H,15,16)
InChIKeyUIHIDPRHXLWYGU-UHFFFAOYSA-N
MW267.28 g/mol
LogP3.26
Rot. Bonds4

About 2-[2-fluoro-4-(1,3-thiazol-2-yloxy)phenyl]propanoic acid

2-[2-fluoro-4-(1,3-thiazol-2-yloxy)phenyl]propanoic acid (PubChem CID 12785124) has the molecular formula C12H10FNO3S and a molecular weight of 267.28 g/mol. Its IUPAC name is 2-[2-fluoro-4-(1,3-thiazol-2-yloxy)phenyl]propanoic acid.

Molecular Properties

Compound Name2-[2-fluoro-4-(1,3-thiazol-2-yloxy)phenyl]propanoic acid
PubChem CID12785124
Molecular FormulaC12H10FNO3S
Molecular Weight267.28 g/mol
Exact Mass267.04
IUPAC Name2-[2-fluoro-4-(1,3-thiazol-2-yloxy)phenyl]propanoic acid
SMILESCC(C(=O)O)c1ccc(Oc2nccs2)cc1F
InChIInChI=1S/C12H10FNO3S/c1-7(11(15)16)9-3-2-8(6-10(9)13)17-12-14-4-5-18-12/h2-7H,1H3,(H,15,16)
InChIKeyUIHIDPRHXLWYGU-UHFFFAOYSA-N
XLogP3.26
TPSA59.42 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds4
Heavy Atoms18
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500267.28
LogP ≤ 53.26
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze 2-[2-fluoro-4-(1,3-thiazol-2-yloxy)phenyl]propanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[2-fluoro-4-(1,3-thiazol-2-yloxy)phenyl]propanoic acid?
The IUPAC name of 2-[2-fluoro-4-(1,3-thiazol-2-yloxy)phenyl]propanoic acid (CID 12785124) is 2-[2-fluoro-4-(1,3-thiazol-2-yloxy)phenyl]propanoic acid.
What is the SMILES notation for 2-[2-fluoro-4-(1,3-thiazol-2-yloxy)phenyl]propanoic acid?
The canonical SMILES for 2-[2-fluoro-4-(1,3-thiazol-2-yloxy)phenyl]propanoic acid is CC(C(=O)O)c1ccc(Oc2nccs2)cc1F.
What is the InChIKey of 2-[2-fluoro-4-(1,3-thiazol-2-yloxy)phenyl]propanoic acid?
The InChIKey is UIHIDPRHXLWYGU-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10FNO3S/c1-7(11(15)16)9-3-2-8(6-10(9)13)17-12-14-4-5-18-12/h2-7H,1H3,(H,15,16).
What are the key properties of 2-[2-fluoro-4-(1,3-thiazol-2-yloxy)phenyl]propanoic acid?
2-[2-fluoro-4-(1,3-thiazol-2-yloxy)phenyl]propanoic acid has a molecular weight of 267.28 g/mol, XLogP of 3.26, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-fluoro-4-(1,3-thiazol-2-yloxy)phenyl]propanoic acid is sourced from PubChem (CID 12785124), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).