About [(7-chloro-5-phenyl-3H-1,4-benzodiazepin-2-yl)amino] N-[2-(trifluoromethyl)phenyl]carbamate
[(7-chloro-5-phenyl-3H-1,4-benzodiazepin-2-yl)amino] N-[2-(trifluoromethyl)phenyl]carbamate (PubChem CID 12785866) has the molecular formula C23H16ClF3N4O2
and a molecular weight of 472.85 g/mol. Its IUPAC name is [(7-chloro-5-phenyl-3H-1,4-benzodiazepin-2-yl)amino] N-[2-(trifluoromethyl)phenyl]carbamate.
Molecular Properties
| Compound Name | [(7-chloro-5-phenyl-3H-1,4-benzodiazepin-2-yl)amino] N-[2-(trifluoromethyl)phenyl]carbamate |
| PubChem CID | 12785866 |
| Molecular Formula | C23H16ClF3N4O2 |
| Molecular Weight | 472.85 g/mol |
| Exact Mass | 472.09 |
| IUPAC Name | [(7-chloro-5-phenyl-3H-1,4-benzodiazepin-2-yl)amino] N-[2-(trifluoromethyl)phenyl]carbamate |
| SMILES | O=C(Nc1ccccc1C(F)(F)F)ONC1=Nc2ccc(Cl)cc2C(c2ccccc2)=NC1 |
| InChI | InChI=1S/C23H16ClF3N4O2/c24-15-10-11-18-16(12-15)21(14-6-2-1-3-7-14)28-13-20(29-18)31-33-22(32)30-19-9-5-4-8-17(19)23(25,26)27/h1-12H,13H2,(H,29,31)(H,30,32) |
| InChIKey | NAALOJANVXCUFF-UHFFFAOYSA-N |
| XLogP | 5.99 |
| TPSA | 75.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 472.85 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [(7-chloro-5-phenyl-3H-1,4-benzodiazepin-2-yl)amino] N-[2-(trifluoromethyl)phenyl]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(7-chloro-5-phenyl-3H-1,4-benzodiazepin-2-yl)amino] N-[2-(trifluoromethyl)phenyl]carbamate?
The IUPAC name of [(7-chloro-5-phenyl-3H-1,4-benzodiazepin-2-yl)amino] N-[2-(trifluoromethyl)phenyl]carbamate (CID 12785866) is [(7-chloro-5-phenyl-3H-1,4-benzodiazepin-2-yl)amino] N-[2-(trifluoromethyl)phenyl]carbamate.
What is the SMILES notation for [(7-chloro-5-phenyl-3H-1,4-benzodiazepin-2-yl)amino] N-[2-(trifluoromethyl)phenyl]carbamate?
The canonical SMILES for [(7-chloro-5-phenyl-3H-1,4-benzodiazepin-2-yl)amino] N-[2-(trifluoromethyl)phenyl]carbamate is O=C(Nc1ccccc1C(F)(F)F)ONC1=Nc2ccc(Cl)cc2C(c2ccccc2)=NC1.
What is the InChIKey of [(7-chloro-5-phenyl-3H-1,4-benzodiazepin-2-yl)amino] N-[2-(trifluoromethyl)phenyl]carbamate?
The InChIKey is NAALOJANVXCUFF-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H16ClF3N4O2/c24-15-10-11-18-16(12-15)21(14-6-2-1-3-7-14)28-13-20(29-18)31-33-22(32)30-19-9-5-4-8-17(19)23(25,26)27/h1-12H,13H2,(H,29,31)(H,30,32).
What are the key properties of [(7-chloro-5-phenyl-3H-1,4-benzodiazepin-2-yl)amino] N-[2-(trifluoromethyl)phenyl]carbamate?
[(7-chloro-5-phenyl-3H-1,4-benzodiazepin-2-yl)amino] N-[2-(trifluoromethyl)phenyl]carbamate has a molecular weight of 472.85 g/mol, XLogP of 5.99, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [(7-chloro-5-phenyl-3H-1,4-benzodiazepin-2-yl)amino] N-[2-(trifluoromethyl)phenyl]carbamate is sourced from PubChem (CID 12785866), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).