About [(E,4S)-1-iodo-4-methyloct-1-en-4-yl]oxy-trimethylsilane
[(E,4S)-1-iodo-4-methyloct-1-en-4-yl]oxy-trimethylsilane (PubChem CID 12786201) has the molecular formula C12H25IOSi
and a molecular weight of 340.32 g/mol. Its IUPAC name is [(E,4S)-1-iodo-4-methyloct-1-en-4-yl]oxy-trimethylsilane.
Molecular Properties
| Compound Name | [(E,4S)-1-iodo-4-methyloct-1-en-4-yl]oxy-trimethylsilane |
| PubChem CID | 12786201 |
| Molecular Formula | C12H25IOSi |
| Molecular Weight | 340.32 g/mol |
| Exact Mass | 340.07 |
| IUPAC Name | [(E,4S)-1-iodo-4-methyloct-1-en-4-yl]oxy-trimethylsilane |
| SMILES | CCCC[C@@](C)(C/C=C/I)O[Si](C)(C)C |
| InChI | InChI=1S/C12H25IOSi/c1-6-7-9-12(2,10-8-11-13)14-15(3,4)5/h8,11H,6-7,9-10H2,1-5H3/b11-8+/t12-/m0/s1 |
| InChIKey | QNNMQGJWDMVGRA-OBIHZWKSSA-N |
| XLogP | 5.13 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 340.32 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze [(E,4S)-1-iodo-4-methyloct-1-en-4-yl]oxy-trimethylsilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(E,4S)-1-iodo-4-methyloct-1-en-4-yl]oxy-trimethylsilane?
The IUPAC name of [(E,4S)-1-iodo-4-methyloct-1-en-4-yl]oxy-trimethylsilane (CID 12786201) is [(E,4S)-1-iodo-4-methyloct-1-en-4-yl]oxy-trimethylsilane.
What is the SMILES notation for [(E,4S)-1-iodo-4-methyloct-1-en-4-yl]oxy-trimethylsilane?
The canonical SMILES for [(E,4S)-1-iodo-4-methyloct-1-en-4-yl]oxy-trimethylsilane is CCCC[C@@](C)(C/C=C/I)O[Si](C)(C)C.
What is the InChIKey of [(E,4S)-1-iodo-4-methyloct-1-en-4-yl]oxy-trimethylsilane?
The InChIKey is QNNMQGJWDMVGRA-OBIHZWKSSA-N. The full InChI is InChI=1S/C12H25IOSi/c1-6-7-9-12(2,10-8-11-13)14-15(3,4)5/h8,11H,6-7,9-10H2,1-5H3/b11-8+/t12-/m0/s1.
What are the key properties of [(E,4S)-1-iodo-4-methyloct-1-en-4-yl]oxy-trimethylsilane?
[(E,4S)-1-iodo-4-methyloct-1-en-4-yl]oxy-trimethylsilane has a molecular weight of 340.32 g/mol, XLogP of 5.13, 7 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for [(E,4S)-1-iodo-4-methyloct-1-en-4-yl]oxy-trimethylsilane is sourced from PubChem (CID 12786201), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).