4-(imidazo[1,2-a]pyridin-2-ylmethoxy)benzoic acid

C15H12N2O3 — CID 1278630

IUPAC4-(imidazo[1,2-a]pyridin-2-ylmethoxy)benzoic acid
SMILESO=C(O)c1ccc(OCc2cn3ccccc3n2)cc1
InChIInChI=1S/C15H12N2O3/c18-15(19)11-4-6-13(7-5-11)20-10-12-9-17-8-2-1-3-14(17)16-12/h1-9H,10H2,(H,18,19)
InChIKeyKUKPPSPGBJACEI-UHFFFAOYSA-N
MW268.27 g/mol
LogP2.61
Rot. Bonds4

About 4-(imidazo[1,2-a]pyridin-2-ylmethoxy)benzoic acid

4-(imidazo[1,2-a]pyridin-2-ylmethoxy)benzoic acid (PubChem CID 1278630) has the molecular formula C15H12N2O3 and a molecular weight of 268.27 g/mol. Its IUPAC name is 4-(imidazo[1,2-a]pyridin-2-ylmethoxy)benzoic acid.

Molecular Properties

Compound Name4-(imidazo[1,2-a]pyridin-2-ylmethoxy)benzoic acid
PubChem CID1278630
Molecular FormulaC15H12N2O3
Molecular Weight268.27 g/mol
Exact Mass268.08
IUPAC Name4-(imidazo[1,2-a]pyridin-2-ylmethoxy)benzoic acid
SMILESO=C(O)c1ccc(OCc2cn3ccccc3n2)cc1
InChIInChI=1S/C15H12N2O3/c18-15(19)11-4-6-13(7-5-11)20-10-12-9-17-8-2-1-3-14(17)16-12/h1-9H,10H2,(H,18,19)
InChIKeyKUKPPSPGBJACEI-UHFFFAOYSA-N
XLogP2.61
TPSA63.83 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds4
Heavy Atoms20
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500268.27
LogP ≤ 52.61
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze 4-(imidazo[1,2-a]pyridin-2-ylmethoxy)benzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-(imidazo[1,2-a]pyridin-2-ylmethoxy)benzoic acid?
The IUPAC name of 4-(imidazo[1,2-a]pyridin-2-ylmethoxy)benzoic acid (CID 1278630) is 4-(imidazo[1,2-a]pyridin-2-ylmethoxy)benzoic acid.
What is the SMILES notation for 4-(imidazo[1,2-a]pyridin-2-ylmethoxy)benzoic acid?
The canonical SMILES for 4-(imidazo[1,2-a]pyridin-2-ylmethoxy)benzoic acid is O=C(O)c1ccc(OCc2cn3ccccc3n2)cc1.
What is the InChIKey of 4-(imidazo[1,2-a]pyridin-2-ylmethoxy)benzoic acid?
The InChIKey is KUKPPSPGBJACEI-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H12N2O3/c18-15(19)11-4-6-13(7-5-11)20-10-12-9-17-8-2-1-3-14(17)16-12/h1-9H,10H2,(H,18,19).
What are the key properties of 4-(imidazo[1,2-a]pyridin-2-ylmethoxy)benzoic acid?
4-(imidazo[1,2-a]pyridin-2-ylmethoxy)benzoic acid has a molecular weight of 268.27 g/mol, XLogP of 2.61, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(imidazo[1,2-a]pyridin-2-ylmethoxy)benzoic acid is sourced from PubChem (CID 1278630), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).