C35H39NO5 — CID 12786379
(Z)-7-[(1R,2R,5S)-2-morpholin-4-yl-3-oxo-5-[[4-(4-phenylphenyl)phenyl]methoxy]cyclopentyl]hept-4-enoic acid (PubChem CID 12786379) has the molecular formula C35H39NO5 and a molecular weight of 553.70 g/mol. Its IUPAC name is (Z)-7-[(1R,2R,5S)-2-morpholin-4-yl-3-oxo-5-[[4-(4-phenylphenyl)phenyl]methoxy]cyclopentyl]hept-4-enoic acid.
| Compound Name | (Z)-7-[(1R,2R,5S)-2-morpholin-4-yl-3-oxo-5-[[4-(4-phenylphenyl)phenyl]methoxy]cyclopentyl]hept-4-enoic acid |
|---|---|
| PubChem CID | 12786379 |
| Molecular Formula | C35H39NO5 |
| Molecular Weight | 553.70 g/mol |
| Exact Mass | 553.28 |
| IUPAC Name | (Z)-7-[(1R,2R,5S)-2-morpholin-4-yl-3-oxo-5-[[4-(4-phenylphenyl)phenyl]methoxy]cyclopentyl]hept-4-enoic acid |
| SMILES | O=C(O)CC/C=C\CC[C@H]1[C@@H](OCc2ccc(-c3ccc(-c4ccccc4)cc3)cc2)CC(=O)[C@@H]1N1CCOCC1 |
| InChI | InChI=1S/C35H39NO5/c37-32-24-33(31(10-6-1-2-7-11-34(38)39)35(32)36-20-22-40-23-21-36)41-25-26-12-14-28(15-13-26)30-18-16-29(17-19-30)27-8-4-3-5-9-27/h1-5,8-9,12-19,31,33,35H,6-7,10-11,20-25H2,(H,38,39)/b2-1-/t31-,33-,35+/m0/s1 |
| InChIKey | FTTKRKUHCGAVPX-BMANZTBMSA-N |
| XLogP | 6.40 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.70 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|