About N-[2-(1,4-dimethylpyrimido[1,6-a]indol-5-yl)ethyl]-N-methylpropan-2-amine
N-[2-(1,4-dimethylpyrimido[1,6-a]indol-5-yl)ethyl]-N-methylpropan-2-amine (PubChem CID 12786430) has the molecular formula C19H25N3
and a molecular weight of 295.43 g/mol. Its IUPAC name is N-[2-(1,4-dimethylpyrimido[1,6-a]indol-5-yl)ethyl]-N-methylpropan-2-amine.
Molecular Properties
| Compound Name | N-[2-(1,4-dimethylpyrimido[1,6-a]indol-5-yl)ethyl]-N-methylpropan-2-amine |
| PubChem CID | 12786430 |
| Molecular Formula | C19H25N3 |
| Molecular Weight | 295.43 g/mol |
| Exact Mass | 295.20 |
| IUPAC Name | N-[2-(1,4-dimethylpyrimido[1,6-a]indol-5-yl)ethyl]-N-methylpropan-2-amine |
| SMILES | Cc1cnc(C)n2c1c(CCN(C)C(C)C)c1ccccc12 |
| InChI | InChI=1S/C19H25N3/c1-13(2)21(5)11-10-17-16-8-6-7-9-18(16)22-15(4)20-12-14(3)19(17)22/h6-9,12-13H,10-11H2,1-5H3 |
| InChIKey | XDKJKAUAQZJONC-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 20.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 295.43 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-[2-(1,4-dimethylpyrimido[1,6-a]indol-5-yl)ethyl]-N-methylpropan-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-(1,4-dimethylpyrimido[1,6-a]indol-5-yl)ethyl]-N-methylpropan-2-amine?
The IUPAC name of N-[2-(1,4-dimethylpyrimido[1,6-a]indol-5-yl)ethyl]-N-methylpropan-2-amine (CID 12786430) is N-[2-(1,4-dimethylpyrimido[1,6-a]indol-5-yl)ethyl]-N-methylpropan-2-amine.
What is the SMILES notation for N-[2-(1,4-dimethylpyrimido[1,6-a]indol-5-yl)ethyl]-N-methylpropan-2-amine?
The canonical SMILES for N-[2-(1,4-dimethylpyrimido[1,6-a]indol-5-yl)ethyl]-N-methylpropan-2-amine is Cc1cnc(C)n2c1c(CCN(C)C(C)C)c1ccccc12.
What is the InChIKey of N-[2-(1,4-dimethylpyrimido[1,6-a]indol-5-yl)ethyl]-N-methylpropan-2-amine?
The InChIKey is XDKJKAUAQZJONC-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H25N3/c1-13(2)21(5)11-10-17-16-8-6-7-9-18(16)22-15(4)20-12-14(3)19(17)22/h6-9,12-13H,10-11H2,1-5H3.
What are the key properties of N-[2-(1,4-dimethylpyrimido[1,6-a]indol-5-yl)ethyl]-N-methylpropan-2-amine?
N-[2-(1,4-dimethylpyrimido[1,6-a]indol-5-yl)ethyl]-N-methylpropan-2-amine has a molecular weight of 295.43 g/mol, XLogP of 3.99, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-(1,4-dimethylpyrimido[1,6-a]indol-5-yl)ethyl]-N-methylpropan-2-amine is sourced from PubChem (CID 12786430), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).