About 1-[(3,4-dimethoxyphenyl)methyl]-6-methoxy-3,4-dihydroisoquinoline;hydrochloride
1-[(3,4-dimethoxyphenyl)methyl]-6-methoxy-3,4-dihydroisoquinoline;hydrochloride (PubChem CID 12786859) has the molecular formula C19H22ClNO3
and a molecular weight of 347.84 g/mol. Its IUPAC name is 1-[(3,4-dimethoxyphenyl)methyl]-6-methoxy-3,4-dihydroisoquinoline;hydrochloride.
Molecular Properties
| Compound Name | 1-[(3,4-dimethoxyphenyl)methyl]-6-methoxy-3,4-dihydroisoquinoline;hydrochloride |
| PubChem CID | 12786859 |
| Molecular Formula | C19H22ClNO3 |
| Molecular Weight | 347.84 g/mol |
| Exact Mass | 347.13 |
| IUPAC Name | 1-[(3,4-dimethoxyphenyl)methyl]-6-methoxy-3,4-dihydroisoquinoline;hydrochloride |
| SMILES | COc1ccc2c(c1)CCN=C2Cc1ccc(OC)c(OC)c1.Cl |
| InChI | InChI=1S/C19H21NO3.ClH/c1-21-15-5-6-16-14(12-15)8-9-20-17(16)10-13-4-7-18(22-2)19(11-13)23-3;/h4-7,11-12H,8-10H2,1-3H3;1H |
| InChIKey | ALOAAQIBFZGSOS-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 40.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 347.84 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-[(3,4-dimethoxyphenyl)methyl]-6-methoxy-3,4-dihydroisoquinoline;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(3,4-dimethoxyphenyl)methyl]-6-methoxy-3,4-dihydroisoquinoline;hydrochloride?
The IUPAC name of 1-[(3,4-dimethoxyphenyl)methyl]-6-methoxy-3,4-dihydroisoquinoline;hydrochloride (CID 12786859) is 1-[(3,4-dimethoxyphenyl)methyl]-6-methoxy-3,4-dihydroisoquinoline;hydrochloride.
What is the SMILES notation for 1-[(3,4-dimethoxyphenyl)methyl]-6-methoxy-3,4-dihydroisoquinoline;hydrochloride?
The canonical SMILES for 1-[(3,4-dimethoxyphenyl)methyl]-6-methoxy-3,4-dihydroisoquinoline;hydrochloride is COc1ccc2c(c1)CCN=C2Cc1ccc(OC)c(OC)c1.Cl.
What is the InChIKey of 1-[(3,4-dimethoxyphenyl)methyl]-6-methoxy-3,4-dihydroisoquinoline;hydrochloride?
The InChIKey is ALOAAQIBFZGSOS-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H21NO3.ClH/c1-21-15-5-6-16-14(12-15)8-9-20-17(16)10-13-4-7-18(22-2)19(11-13)23-3;/h4-7,11-12H,8-10H2,1-3H3;1H.
What are the key properties of 1-[(3,4-dimethoxyphenyl)methyl]-6-methoxy-3,4-dihydroisoquinoline;hydrochloride?
1-[(3,4-dimethoxyphenyl)methyl]-6-methoxy-3,4-dihydroisoquinoline;hydrochloride has a molecular weight of 347.84 g/mol, XLogP of 3.72, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(3,4-dimethoxyphenyl)methyl]-6-methoxy-3,4-dihydroisoquinoline;hydrochloride is sourced from PubChem (CID 12786859), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).