About 2-(5-methyl-1H-1,2,4-triazol-3-yl)pyridine
2-(5-methyl-1H-1,2,4-triazol-3-yl)pyridine (PubChem CID 12787364) has the molecular formula C8H8N4
and a molecular weight of 160.18 g/mol. Its IUPAC name is 2-(5-methyl-1H-1,2,4-triazol-3-yl)pyridine.
Molecular Properties
| Compound Name | 2-(5-methyl-1H-1,2,4-triazol-3-yl)pyridine |
| PubChem CID | 12787364 |
| Molecular Formula | C8H8N4 |
| Molecular Weight | 160.18 g/mol |
| Exact Mass | 160.07 |
| IUPAC Name | 2-(5-methyl-1H-1,2,4-triazol-3-yl)pyridine |
| SMILES | Cc1nc(-c2ccccn2)n[nH]1 |
| InChI | InChI=1S/C8H8N4/c1-6-10-8(12-11-6)7-4-2-3-5-9-7/h2-5H,1H3,(H,10,11,12) |
| InChIKey | BJDVHKDTPXZGEZ-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 160.18 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(5-methyl-1H-1,2,4-triazol-3-yl)pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(5-methyl-1H-1,2,4-triazol-3-yl)pyridine?
The IUPAC name of 2-(5-methyl-1H-1,2,4-triazol-3-yl)pyridine (CID 12787364) is 2-(5-methyl-1H-1,2,4-triazol-3-yl)pyridine.
What is the SMILES notation for 2-(5-methyl-1H-1,2,4-triazol-3-yl)pyridine?
The canonical SMILES for 2-(5-methyl-1H-1,2,4-triazol-3-yl)pyridine is Cc1nc(-c2ccccn2)n[nH]1.
What is the InChIKey of 2-(5-methyl-1H-1,2,4-triazol-3-yl)pyridine?
The InChIKey is BJDVHKDTPXZGEZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8N4/c1-6-10-8(12-11-6)7-4-2-3-5-9-7/h2-5H,1H3,(H,10,11,12).
What are the key properties of 2-(5-methyl-1H-1,2,4-triazol-3-yl)pyridine?
2-(5-methyl-1H-1,2,4-triazol-3-yl)pyridine has a molecular weight of 160.18 g/mol, XLogP of 1.18, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(5-methyl-1H-1,2,4-triazol-3-yl)pyridine is sourced from PubChem (CID 12787364), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).