C8H11N3O2 — CID 12787584
3-(3-methyl-6-oxopyridazin-1-yl)propanamide (PubChem CID 12787584) has the molecular formula C8H11N3O2 and a molecular weight of 181.20 g/mol. Its IUPAC name is 3-(3-methyl-6-oxopyridazin-1-yl)propanamide.
| Compound Name | 3-(3-methyl-6-oxopyridazin-1-yl)propanamide |
|---|---|
| PubChem CID | 12787584 |
| Molecular Formula | C8H11N3O2 |
| Molecular Weight | 181.20 g/mol |
| Exact Mass | 181.09 |
| IUPAC Name | 3-(3-methyl-6-oxopyridazin-1-yl)propanamide |
| SMILES | Cc1ccc(=O)n(CCC(N)=O)n1 |
| InChI | InChI=1S/C8H11N3O2/c1-6-2-3-8(13)11(10-6)5-4-7(9)12/h2-3H,4-5H2,1H3,(H2,9,12) |
| InChIKey | UEERNJUTWAOYDY-UHFFFAOYSA-N |
| XLogP | -0.57 |
| TPSA | 77.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.20 |
| LogP ≤ 5 | -0.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |