About 1,3-dicyclohexyl-1,3-dimethylselenourea
1,3-dicyclohexyl-1,3-dimethylselenourea (PubChem CID 12787622) has the molecular formula C15H28N2Se
and a molecular weight of 315.36 g/mol. Its IUPAC name is 1,3-dicyclohexyl-1,3-dimethylselenourea.
Molecular Properties
| Compound Name | 1,3-dicyclohexyl-1,3-dimethylselenourea |
| PubChem CID | 12787622 |
| Molecular Formula | C15H28N2Se |
| Molecular Weight | 315.36 g/mol |
| Exact Mass | 316.14 |
| IUPAC Name | 1,3-dicyclohexyl-1,3-dimethylselenourea |
| SMILES | CN(C(=[Se])N(C)C1CCCCC1)C1CCCCC1 |
| InChI | InChI=1S/C15H28N2Se/c1-16(13-9-5-3-6-10-13)15(18)17(2)14-11-7-4-8-12-14/h13-14H,3-12H2,1-2H3 |
| InChIKey | LMJYHPVSKRPZPY-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 315.36 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 1,3-dicyclohexyl-1,3-dimethylselenourea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3-dicyclohexyl-1,3-dimethylselenourea?
The IUPAC name of 1,3-dicyclohexyl-1,3-dimethylselenourea (CID 12787622) is 1,3-dicyclohexyl-1,3-dimethylselenourea.
What is the SMILES notation for 1,3-dicyclohexyl-1,3-dimethylselenourea?
The canonical SMILES for 1,3-dicyclohexyl-1,3-dimethylselenourea is CN(C(=[Se])N(C)C1CCCCC1)C1CCCCC1.
What is the InChIKey of 1,3-dicyclohexyl-1,3-dimethylselenourea?
The InChIKey is LMJYHPVSKRPZPY-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H28N2Se/c1-16(13-9-5-3-6-10-13)15(18)17(2)14-11-7-4-8-12-14/h13-14H,3-12H2,1-2H3.
What are the key properties of 1,3-dicyclohexyl-1,3-dimethylselenourea?
1,3-dicyclohexyl-1,3-dimethylselenourea has a molecular weight of 315.36 g/mol, XLogP of 2.77, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3-dicyclohexyl-1,3-dimethylselenourea is sourced from PubChem (CID 12787622), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).