C25H30N3O3+ — CID 12788096
9,10-dimethoxy-3-methyl-2-(N,2,4,6-tetramethylanilino)-6,7-dihydropyrimido[6,1-a]isoquinolin-3-ium-4-one (PubChem CID 12788096) has the molecular formula C25H30N3O3+ and a molecular weight of 420.53 g/mol. Its IUPAC name is 9,10-dimethoxy-3-methyl-2-(N,2,4,6-tetramethylanilino)-6,7-dihydropyrimido[6,1-a]isoquinolin-3-ium-4-one.
| Compound Name | 9,10-dimethoxy-3-methyl-2-(N,2,4,6-tetramethylanilino)-6,7-dihydropyrimido[6,1-a]isoquinolin-3-ium-4-one |
|---|---|
| PubChem CID | 12788096 |
| Molecular Formula | C25H30N3O3+ |
| Molecular Weight | 420.53 g/mol |
| Exact Mass | 420.23 |
| IUPAC Name | 9,10-dimethoxy-3-methyl-2-(N,2,4,6-tetramethylanilino)-6,7-dihydropyrimido[6,1-a]isoquinolin-3-ium-4-one |
| SMILES | COc1cc2c(cc1OC)-c1cc(N(C)c3c(C)cc(C)cc3C)[n+](C)c(=O)n1CC2 |
| InChI | InChI=1S/C25H30N3O3/c1-15-10-16(2)24(17(3)11-15)26(4)23-14-20-19-13-22(31-7)21(30-6)12-18(19)8-9-28(20)25(29)27(23)5/h10-14H,8-9H2,1-7H3/q+1 |
| InChIKey | DELXOHBXSTXSJV-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 47.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.53 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|