About N-cyclopentyl-N'-(2-cyclopropyloxan-4-yl)butanediamide
N-cyclopentyl-N'-(2-cyclopropyloxan-4-yl)butanediamide (PubChem CID 127882118) has the molecular formula C17H28N2O3
and a molecular weight of 308.42 g/mol. Its IUPAC name is N-cyclopentyl-N'-(2-cyclopropyloxan-4-yl)butanediamide.
Molecular Properties
| Compound Name | N-cyclopentyl-N'-(2-cyclopropyloxan-4-yl)butanediamide |
| PubChem CID | 127882118 |
| Molecular Formula | C17H28N2O3 |
| Molecular Weight | 308.42 g/mol |
| Exact Mass | 308.21 |
| IUPAC Name | N-cyclopentyl-N'-(2-cyclopropyloxan-4-yl)butanediamide |
| SMILES | O=C(CCC(=O)NC1CCOC(C2CC2)C1)NC1CCCC1 |
| InChI | InChI=1S/C17H28N2O3/c20-16(18-13-3-1-2-4-13)7-8-17(21)19-14-9-10-22-15(11-14)12-5-6-12/h12-15H,1-11H2,(H,18,20)(H,19,21) |
| InChIKey | ASMFOBKFDVFDSK-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 308.42 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-cyclopentyl-N'-(2-cyclopropyloxan-4-yl)butanediamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-cyclopentyl-N'-(2-cyclopropyloxan-4-yl)butanediamide?
The IUPAC name of N-cyclopentyl-N'-(2-cyclopropyloxan-4-yl)butanediamide (CID 127882118) is N-cyclopentyl-N'-(2-cyclopropyloxan-4-yl)butanediamide.
What is the SMILES notation for N-cyclopentyl-N'-(2-cyclopropyloxan-4-yl)butanediamide?
The canonical SMILES for N-cyclopentyl-N'-(2-cyclopropyloxan-4-yl)butanediamide is O=C(CCC(=O)NC1CCOC(C2CC2)C1)NC1CCCC1.
What is the InChIKey of N-cyclopentyl-N'-(2-cyclopropyloxan-4-yl)butanediamide?
The InChIKey is ASMFOBKFDVFDSK-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H28N2O3/c20-16(18-13-3-1-2-4-13)7-8-17(21)19-14-9-10-22-15(11-14)12-5-6-12/h12-15H,1-11H2,(H,18,20)(H,19,21).
What are the key properties of N-cyclopentyl-N'-(2-cyclopropyloxan-4-yl)butanediamide?
N-cyclopentyl-N'-(2-cyclopropyloxan-4-yl)butanediamide has a molecular weight of 308.42 g/mol, XLogP of 1.90, 6 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-cyclopentyl-N'-(2-cyclopropyloxan-4-yl)butanediamide is sourced from PubChem (CID 127882118), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).