C22H36O2 — CID 12788220
2-[(1R,2S,5R)-5-hydroxy-2-methylcyclohexyl]-5-(2-methyloctan-2-yl)phenol (PubChem CID 12788220) has the molecular formula C22H36O2 and a molecular weight of 332.53 g/mol. Its IUPAC name is 2-[(1R,2S,5R)-5-hydroxy-2-methylcyclohexyl]-5-(2-methyloctan-2-yl)phenol.
| Compound Name | 2-[(1R,2S,5R)-5-hydroxy-2-methylcyclohexyl]-5-(2-methyloctan-2-yl)phenol |
|---|---|
| PubChem CID | 12788220 |
| Molecular Formula | C22H36O2 |
| Molecular Weight | 332.53 g/mol |
| Exact Mass | 332.27 |
| IUPAC Name | 2-[(1R,2S,5R)-5-hydroxy-2-methylcyclohexyl]-5-(2-methyloctan-2-yl)phenol |
| SMILES | CCCCCCC(C)(C)c1ccc([C@@H]2C[C@H](O)CC[C@@H]2C)c(O)c1 |
| InChI | InChI=1S/C22H36O2/c1-5-6-7-8-13-22(3,4)17-10-12-19(21(24)14-17)20-15-18(23)11-9-16(20)2/h10,12,14,16,18,20,23-24H,5-9,11,13,15H2,1-4H3/t16-,18+,20+/m0/s1 |
| InChIKey | OTPOYNIGJRTIFG-ILZDJORESA-N |
| XLogP | 5.90 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.53 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|