About (3R,4R)-4-(4-methoxyphenoxy)-1-methyl-3-phenylpiperidine;hydrochloride
(3R,4R)-4-(4-methoxyphenoxy)-1-methyl-3-phenylpiperidine;hydrochloride (PubChem CID 12788440) has the molecular formula C19H24ClNO2
and a molecular weight of 333.86 g/mol. Its IUPAC name is (3R,4R)-4-(4-methoxyphenoxy)-1-methyl-3-phenylpiperidine;hydrochloride.
Molecular Properties
| Compound Name | (3R,4R)-4-(4-methoxyphenoxy)-1-methyl-3-phenylpiperidine;hydrochloride |
| PubChem CID | 12788440 |
| Molecular Formula | C19H24ClNO2 |
| Molecular Weight | 333.86 g/mol |
| Exact Mass | 333.15 |
| IUPAC Name | (3R,4R)-4-(4-methoxyphenoxy)-1-methyl-3-phenylpiperidine;hydrochloride |
| SMILES | COc1ccc(O[C@@H]2CCN(C)C[C@H]2c2ccccc2)cc1.Cl |
| InChI | InChI=1S/C19H23NO2.ClH/c1-20-13-12-19(18(14-20)15-6-4-3-5-7-15)22-17-10-8-16(21-2)9-11-17;/h3-11,18-19H,12-14H2,1-2H3;1H/t18-,19+;/m0./s1 |
| InChIKey | PFBFKAKLDXBUFO-GRTNUQQKSA-N |
| XLogP | 3.98 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 333.86 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (3R,4R)-4-(4-methoxyphenoxy)-1-methyl-3-phenylpiperidine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3R,4R)-4-(4-methoxyphenoxy)-1-methyl-3-phenylpiperidine;hydrochloride?
The IUPAC name of (3R,4R)-4-(4-methoxyphenoxy)-1-methyl-3-phenylpiperidine;hydrochloride (CID 12788440) is (3R,4R)-4-(4-methoxyphenoxy)-1-methyl-3-phenylpiperidine;hydrochloride.
What is the SMILES notation for (3R,4R)-4-(4-methoxyphenoxy)-1-methyl-3-phenylpiperidine;hydrochloride?
The canonical SMILES for (3R,4R)-4-(4-methoxyphenoxy)-1-methyl-3-phenylpiperidine;hydrochloride is COc1ccc(O[C@@H]2CCN(C)C[C@H]2c2ccccc2)cc1.Cl.
What is the InChIKey of (3R,4R)-4-(4-methoxyphenoxy)-1-methyl-3-phenylpiperidine;hydrochloride?
The InChIKey is PFBFKAKLDXBUFO-GRTNUQQKSA-N. The full InChI is InChI=1S/C19H23NO2.ClH/c1-20-13-12-19(18(14-20)15-6-4-3-5-7-15)22-17-10-8-16(21-2)9-11-17;/h3-11,18-19H,12-14H2,1-2H3;1H/t18-,19+;/m0./s1.
What are the key properties of (3R,4R)-4-(4-methoxyphenoxy)-1-methyl-3-phenylpiperidine;hydrochloride?
(3R,4R)-4-(4-methoxyphenoxy)-1-methyl-3-phenylpiperidine;hydrochloride has a molecular weight of 333.86 g/mol, XLogP of 3.98, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3R,4R)-4-(4-methoxyphenoxy)-1-methyl-3-phenylpiperidine;hydrochloride is sourced from PubChem (CID 12788440), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).