C19H24ClNO2 — CID 12788440
(3R,4R)-4-(4-methoxyphenoxy)-1-methyl-3-phenylpiperidine;hydrochloride (PubChem CID 12788440) has the molecular formula C19H24ClNO2 and a molecular weight of 333.86 g/mol. Its IUPAC name is (3R,4R)-4-(4-methoxyphenoxy)-1-methyl-3-phenylpiperidine;hydrochloride.
| Compound Name | (3R,4R)-4-(4-methoxyphenoxy)-1-methyl-3-phenylpiperidine;hydrochloride |
|---|---|
| PubChem CID | 12788440 |
| Molecular Formula | C19H24ClNO2 |
| Molecular Weight | 333.86 g/mol |
| Exact Mass | 333.15 |
| IUPAC Name | (3R,4R)-4-(4-methoxyphenoxy)-1-methyl-3-phenylpiperidine;hydrochloride |
| SMILES | COc1ccc(O[C@@H]2CCN(C)C[C@H]2c2ccccc2)cc1.Cl |
| InChI | InChI=1S/C19H23NO2.ClH/c1-20-13-12-19(18(14-20)15-6-4-3-5-7-15)22-17-10-8-16(21-2)9-11-17;/h3-11,18-19H,12-14H2,1-2H3;1H/t18-,19+;/m0./s1 |
| InChIKey | PFBFKAKLDXBUFO-GRTNUQQKSA-N |
| XLogP | 3.98 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.86 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |