C7H13N5S2 — CID 12788970
1-methyl-3-[2-(1H-1,2,4-triazol-5-ylmethylsulfanyl)ethyl]thiourea (PubChem CID 12788970) has the molecular formula C7H13N5S2 and a molecular weight of 231.35 g/mol. Its IUPAC name is 1-methyl-3-[2-(1H-1,2,4-triazol-5-ylmethylsulfanyl)ethyl]thiourea.
| Compound Name | 1-methyl-3-[2-(1H-1,2,4-triazol-5-ylmethylsulfanyl)ethyl]thiourea |
|---|---|
| PubChem CID | 12788970 |
| Molecular Formula | C7H13N5S2 |
| Molecular Weight | 231.35 g/mol |
| Exact Mass | 231.06 |
| IUPAC Name | 1-methyl-3-[2-(1H-1,2,4-triazol-5-ylmethylsulfanyl)ethyl]thiourea |
| SMILES | CNC(=S)NCCSCc1ncn[nH]1 |
| InChI | InChI=1S/C7H13N5S2/c1-8-7(13)9-2-3-14-4-6-10-5-11-12-6/h5H,2-4H2,1H3,(H2,8,9,13)(H,10,11,12) |
| InChIKey | BWZBPANIAUMHKV-UHFFFAOYSA-N |
| XLogP | 0.13 |
| TPSA | 65.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.35 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|