About 1-[3-[(5-amino-1,3,4-thiadiazol-2-yl)sulfanyl]propyl]-3-methylthiourea
1-[3-[(5-amino-1,3,4-thiadiazol-2-yl)sulfanyl]propyl]-3-methylthiourea (PubChem CID 12788972) has the molecular formula C7H13N5S3
and a molecular weight of 263.42 g/mol. Its IUPAC name is 1-[3-[(5-amino-1,3,4-thiadiazol-2-yl)sulfanyl]propyl]-3-methylthiourea.
Molecular Properties
| Compound Name | 1-[3-[(5-amino-1,3,4-thiadiazol-2-yl)sulfanyl]propyl]-3-methylthiourea |
| PubChem CID | 12788972 |
| Molecular Formula | C7H13N5S3 |
| Molecular Weight | 263.42 g/mol |
| Exact Mass | 263.03 |
| IUPAC Name | 1-[3-[(5-amino-1,3,4-thiadiazol-2-yl)sulfanyl]propyl]-3-methylthiourea |
| SMILES | CNC(=S)NCCCSc1nnc(N)s1 |
| InChI | InChI=1S/C7H13N5S3/c1-9-6(13)10-3-2-4-14-7-12-11-5(8)15-7/h2-4H2,1H3,(H2,8,11)(H2,9,10,13) |
| InChIKey | HIVPMEYJDYDBDL-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 75.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 263.42 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 1-[3-[(5-amino-1,3,4-thiadiazol-2-yl)sulfanyl]propyl]-3-methylthiourea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[3-[(5-amino-1,3,4-thiadiazol-2-yl)sulfanyl]propyl]-3-methylthiourea?
The IUPAC name of 1-[3-[(5-amino-1,3,4-thiadiazol-2-yl)sulfanyl]propyl]-3-methylthiourea (CID 12788972) is 1-[3-[(5-amino-1,3,4-thiadiazol-2-yl)sulfanyl]propyl]-3-methylthiourea.
What is the SMILES notation for 1-[3-[(5-amino-1,3,4-thiadiazol-2-yl)sulfanyl]propyl]-3-methylthiourea?
The canonical SMILES for 1-[3-[(5-amino-1,3,4-thiadiazol-2-yl)sulfanyl]propyl]-3-methylthiourea is CNC(=S)NCCCSc1nnc(N)s1.
What is the InChIKey of 1-[3-[(5-amino-1,3,4-thiadiazol-2-yl)sulfanyl]propyl]-3-methylthiourea?
The InChIKey is HIVPMEYJDYDBDL-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H13N5S3/c1-9-6(13)10-3-2-4-14-7-12-11-5(8)15-7/h2-4H2,1H3,(H2,8,11)(H2,9,10,13).
What are the key properties of 1-[3-[(5-amino-1,3,4-thiadiazol-2-yl)sulfanyl]propyl]-3-methylthiourea?
1-[3-[(5-amino-1,3,4-thiadiazol-2-yl)sulfanyl]propyl]-3-methylthiourea has a molecular weight of 263.42 g/mol, XLogP of 0.70, 5 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[3-[(5-amino-1,3,4-thiadiazol-2-yl)sulfanyl]propyl]-3-methylthiourea is sourced from PubChem (CID 12788972), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).