About 1-(9H-pyrido[3,4-b]indol-3-yl)ethanone
1-(9H-pyrido[3,4-b]indol-3-yl)ethanone (PubChem CID 12789146) has the molecular formula C13H10N2O
and a molecular weight of 210.24 g/mol. Its IUPAC name is 1-(9H-pyrido[3,4-b]indol-3-yl)ethanone.
Molecular Properties
| Compound Name | 1-(9H-pyrido[3,4-b]indol-3-yl)ethanone |
| PubChem CID | 12789146 |
| Molecular Formula | C13H10N2O |
| Molecular Weight | 210.24 g/mol |
| Exact Mass | 210.08 |
| IUPAC Name | 1-(9H-pyrido[3,4-b]indol-3-yl)ethanone |
| SMILES | CC(=O)c1cc2c(cn1)[nH]c1ccccc12 |
| InChI | InChI=1S/C13H10N2O/c1-8(16)12-6-10-9-4-2-3-5-11(9)15-13(10)7-14-12/h2-7,15H,1H3 |
| InChIKey | MPLXFBXMWYMAFN-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 45.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.24 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-(9H-pyrido[3,4-b]indol-3-yl)ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(9H-pyrido[3,4-b]indol-3-yl)ethanone?
The IUPAC name of 1-(9H-pyrido[3,4-b]indol-3-yl)ethanone (CID 12789146) is 1-(9H-pyrido[3,4-b]indol-3-yl)ethanone.
What is the SMILES notation for 1-(9H-pyrido[3,4-b]indol-3-yl)ethanone?
The canonical SMILES for 1-(9H-pyrido[3,4-b]indol-3-yl)ethanone is CC(=O)c1cc2c(cn1)[nH]c1ccccc12.
What is the InChIKey of 1-(9H-pyrido[3,4-b]indol-3-yl)ethanone?
The InChIKey is MPLXFBXMWYMAFN-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H10N2O/c1-8(16)12-6-10-9-4-2-3-5-11(9)15-13(10)7-14-12/h2-7,15H,1H3.
What are the key properties of 1-(9H-pyrido[3,4-b]indol-3-yl)ethanone?
1-(9H-pyrido[3,4-b]indol-3-yl)ethanone has a molecular weight of 210.24 g/mol, XLogP of 2.92, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(9H-pyrido[3,4-b]indol-3-yl)ethanone is sourced from PubChem (CID 12789146), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).