About tricyclo[6.3.1.02,7]dodeca-2,4,6-trien-10-one
tricyclo[6.3.1.02,7]dodeca-2,4,6-trien-10-one (PubChem CID 12789237) has the molecular formula C12H12O
and a molecular weight of 172.23 g/mol. Its IUPAC name is tricyclo[6.3.1.02,7]dodeca-2,4,6-trien-10-one.
Molecular Properties
| Compound Name | tricyclo[6.3.1.02,7]dodeca-2,4,6-trien-10-one |
| PubChem CID | 12789237 |
| Molecular Formula | C12H12O |
| Molecular Weight | 172.23 g/mol |
| Exact Mass | 172.09 |
| IUPAC Name | tricyclo[6.3.1.02,7]dodeca-2,4,6-trien-10-one |
| SMILES | O=C1CC2CC(C1)c1ccccc12 |
| InChI | InChI=1S/C12H12O/c13-10-6-8-5-9(7-10)12-4-2-1-3-11(8)12/h1-4,8-9H,5-7H2 |
| InChIKey | KEACXSSYYTXFJR-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 172.23 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze tricyclo[6.3.1.02,7]dodeca-2,4,6-trien-10-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tricyclo[6.3.1.02,7]dodeca-2,4,6-trien-10-one?
The IUPAC name of tricyclo[6.3.1.02,7]dodeca-2,4,6-trien-10-one (CID 12789237) is tricyclo[6.3.1.02,7]dodeca-2,4,6-trien-10-one.
What is the SMILES notation for tricyclo[6.3.1.02,7]dodeca-2,4,6-trien-10-one?
The canonical SMILES for tricyclo[6.3.1.02,7]dodeca-2,4,6-trien-10-one is O=C1CC2CC(C1)c1ccccc12.
What is the InChIKey of tricyclo[6.3.1.02,7]dodeca-2,4,6-trien-10-one?
The InChIKey is KEACXSSYYTXFJR-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12O/c13-10-6-8-5-9(7-10)12-4-2-1-3-11(8)12/h1-4,8-9H,5-7H2.
What are the key properties of tricyclo[6.3.1.02,7]dodeca-2,4,6-trien-10-one?
tricyclo[6.3.1.02,7]dodeca-2,4,6-trien-10-one has a molecular weight of 172.23 g/mol, XLogP of 2.62, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for tricyclo[6.3.1.02,7]dodeca-2,4,6-trien-10-one is sourced from PubChem (CID 12789237), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).