About 5-[5-[(2,4-difluorophenyl)iminomethyl]furan-2-yl]-2-methylbenzoic acid
5-[5-[(2,4-difluorophenyl)iminomethyl]furan-2-yl]-2-methylbenzoic acid (PubChem CID 1278926) has the molecular formula C19H13F2NO3
and a molecular weight of 341.31 g/mol. Its IUPAC name is 5-[5-[(2,4-difluorophenyl)iminomethyl]furan-2-yl]-2-methylbenzoic acid.
Molecular Properties
| Compound Name | 5-[5-[(2,4-difluorophenyl)iminomethyl]furan-2-yl]-2-methylbenzoic acid |
| PubChem CID | 1278926 |
| Molecular Formula | C19H13F2NO3 |
| Molecular Weight | 341.31 g/mol |
| Exact Mass | 341.09 |
| IUPAC Name | 5-[5-[(2,4-difluorophenyl)iminomethyl]furan-2-yl]-2-methylbenzoic acid |
| SMILES | Cc1ccc(-c2ccc(/C=N/c3ccc(F)cc3F)o2)cc1C(=O)O |
| InChI | InChI=1S/C19H13F2NO3/c1-11-2-3-12(8-15(11)19(23)24)18-7-5-14(25-18)10-22-17-6-4-13(20)9-16(17)21/h2-10H,1H3,(H,23,24)/b22-10+ |
| InChIKey | NHRMIDRVAMWEHU-LSHDLFTRSA-N |
| XLogP | 4.98 |
| TPSA | 62.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 341.31 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 5-[5-[(2,4-difluorophenyl)iminomethyl]furan-2-yl]-2-methylbenzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[5-[(2,4-difluorophenyl)iminomethyl]furan-2-yl]-2-methylbenzoic acid?
The IUPAC name of 5-[5-[(2,4-difluorophenyl)iminomethyl]furan-2-yl]-2-methylbenzoic acid (CID 1278926) is 5-[5-[(2,4-difluorophenyl)iminomethyl]furan-2-yl]-2-methylbenzoic acid.
What is the SMILES notation for 5-[5-[(2,4-difluorophenyl)iminomethyl]furan-2-yl]-2-methylbenzoic acid?
The canonical SMILES for 5-[5-[(2,4-difluorophenyl)iminomethyl]furan-2-yl]-2-methylbenzoic acid is Cc1ccc(-c2ccc(/C=N/c3ccc(F)cc3F)o2)cc1C(=O)O.
What is the InChIKey of 5-[5-[(2,4-difluorophenyl)iminomethyl]furan-2-yl]-2-methylbenzoic acid?
The InChIKey is NHRMIDRVAMWEHU-LSHDLFTRSA-N. The full InChI is InChI=1S/C19H13F2NO3/c1-11-2-3-12(8-15(11)19(23)24)18-7-5-14(25-18)10-22-17-6-4-13(20)9-16(17)21/h2-10H,1H3,(H,23,24)/b22-10+.
What are the key properties of 5-[5-[(2,4-difluorophenyl)iminomethyl]furan-2-yl]-2-methylbenzoic acid?
5-[5-[(2,4-difluorophenyl)iminomethyl]furan-2-yl]-2-methylbenzoic acid has a molecular weight of 341.31 g/mol, XLogP of 4.98, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[5-[(2,4-difluorophenyl)iminomethyl]furan-2-yl]-2-methylbenzoic acid is sourced from PubChem (CID 1278926), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).