About 11-oxatricyclo[5.3.1.01,5]undec-9-en-8-one
11-oxatricyclo[5.3.1.01,5]undec-9-en-8-one (PubChem CID 12789276) has the molecular formula C10H12O2
and a molecular weight of 164.20 g/mol. Its IUPAC name is 11-oxatricyclo[5.3.1.01,5]undec-9-en-8-one.
Molecular Properties
| Compound Name | 11-oxatricyclo[5.3.1.01,5]undec-9-en-8-one |
| PubChem CID | 12789276 |
| Molecular Formula | C10H12O2 |
| Molecular Weight | 164.20 g/mol |
| Exact Mass | 164.08 |
| IUPAC Name | 11-oxatricyclo[5.3.1.01,5]undec-9-en-8-one |
| SMILES | O=C1C=CC23CCCC2CC1O3 |
| InChI | InChI=1S/C10H12O2/c11-8-3-5-10-4-1-2-7(10)6-9(8)12-10/h3,5,7,9H,1-2,4,6H2 |
| InChIKey | PKUHCAHDPPVTCX-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 164.20 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 11-oxatricyclo[5.3.1.01,5]undec-9-en-8-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 11-oxatricyclo[5.3.1.01,5]undec-9-en-8-one?
The IUPAC name of 11-oxatricyclo[5.3.1.01,5]undec-9-en-8-one (CID 12789276) is 11-oxatricyclo[5.3.1.01,5]undec-9-en-8-one.
What is the SMILES notation for 11-oxatricyclo[5.3.1.01,5]undec-9-en-8-one?
The canonical SMILES for 11-oxatricyclo[5.3.1.01,5]undec-9-en-8-one is O=C1C=CC23CCCC2CC1O3.
What is the InChIKey of 11-oxatricyclo[5.3.1.01,5]undec-9-en-8-one?
The InChIKey is PKUHCAHDPPVTCX-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12O2/c11-8-3-5-10-4-1-2-7(10)6-9(8)12-10/h3,5,7,9H,1-2,4,6H2.
What are the key properties of 11-oxatricyclo[5.3.1.01,5]undec-9-en-8-one?
11-oxatricyclo[5.3.1.01,5]undec-9-en-8-one has a molecular weight of 164.20 g/mol, XLogP of 1.45, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 11-oxatricyclo[5.3.1.01,5]undec-9-en-8-one is sourced from PubChem (CID 12789276), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).