About 2-(4,5,6-trichloropyrimidin-2-yl)guanidine
2-(4,5,6-trichloropyrimidin-2-yl)guanidine (PubChem CID 12789416) has the molecular formula C5H4Cl3N5
and a molecular weight of 240.48 g/mol. Its IUPAC name is 2-(4,5,6-trichloropyrimidin-2-yl)guanidine.
Molecular Properties
| Compound Name | 2-(4,5,6-trichloropyrimidin-2-yl)guanidine |
| PubChem CID | 12789416 |
| Molecular Formula | C5H4Cl3N5 |
| Molecular Weight | 240.48 g/mol |
| Exact Mass | 238.95 |
| IUPAC Name | 2-(4,5,6-trichloropyrimidin-2-yl)guanidine |
| SMILES | NC(N)=Nc1nc(Cl)c(Cl)c(Cl)n1 |
| InChI | InChI=1S/C5H4Cl3N5/c6-1-2(7)11-5(12-3(1)8)13-4(9)10/h(H4,9,10,11,12,13) |
| InChIKey | WASNFONRZULSGG-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 90.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.48 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 2-(4,5,6-trichloropyrimidin-2-yl)guanidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4,5,6-trichloropyrimidin-2-yl)guanidine?
The IUPAC name of 2-(4,5,6-trichloropyrimidin-2-yl)guanidine (CID 12789416) is 2-(4,5,6-trichloropyrimidin-2-yl)guanidine.
What is the SMILES notation for 2-(4,5,6-trichloropyrimidin-2-yl)guanidine?
The canonical SMILES for 2-(4,5,6-trichloropyrimidin-2-yl)guanidine is NC(N)=Nc1nc(Cl)c(Cl)c(Cl)n1.
What is the InChIKey of 2-(4,5,6-trichloropyrimidin-2-yl)guanidine?
The InChIKey is WASNFONRZULSGG-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H4Cl3N5/c6-1-2(7)11-5(12-3(1)8)13-4(9)10/h(H4,9,10,11,12,13).
What are the key properties of 2-(4,5,6-trichloropyrimidin-2-yl)guanidine?
2-(4,5,6-trichloropyrimidin-2-yl)guanidine has a molecular weight of 240.48 g/mol, XLogP of 1.34, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4,5,6-trichloropyrimidin-2-yl)guanidine is sourced from PubChem (CID 12789416), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).