C18H17N3O4S — CID 12789485
8-(3-nitrophenyl)-5-propan-2-yl-7,8-dihydro-[1,3]dioxolo[4,5-g]quinazoline-6-thione (PubChem CID 12789485) has the molecular formula C18H17N3O4S and a molecular weight of 371.42 g/mol. Its IUPAC name is 8-(3-nitrophenyl)-5-propan-2-yl-7,8-dihydro-[1,3]dioxolo[4,5-g]quinazoline-6-thione.
| Compound Name | 8-(3-nitrophenyl)-5-propan-2-yl-7,8-dihydro-[1,3]dioxolo[4,5-g]quinazoline-6-thione |
|---|---|
| PubChem CID | 12789485 |
| Molecular Formula | C18H17N3O4S |
| Molecular Weight | 371.42 g/mol |
| Exact Mass | 371.09 |
| IUPAC Name | 8-(3-nitrophenyl)-5-propan-2-yl-7,8-dihydro-[1,3]dioxolo[4,5-g]quinazoline-6-thione |
| SMILES | CC(C)N1C(=S)NC(c2cccc([N+](=O)[O-])c2)c2cc3c(cc21)OCO3 |
| InChI | InChI=1S/C18H17N3O4S/c1-10(2)20-14-8-16-15(24-9-25-16)7-13(14)17(19-18(20)26)11-4-3-5-12(6-11)21(22)23/h3-8,10,17H,9H2,1-2H3,(H,19,26) |
| InChIKey | ZGYZNPKPZMQFAO-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 76.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.42 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|