C12H11N3O3 — CID 12789548
(2R,7R)-6-oxa-3,9,11-triazatetracyclo[7.6.1.02,7.012,16]hexadeca-1(16),12,14-triene-4,10-dione (PubChem CID 12789548) has the molecular formula C12H11N3O3 and a molecular weight of 245.24 g/mol. Its IUPAC name is (2R,7R)-6-oxa-3,9,11-triazatetracyclo[7.6.1.02,7.012,16]hexadeca-1(16),12,14-triene-4,10-dione.
| Compound Name | (2R,7R)-6-oxa-3,9,11-triazatetracyclo[7.6.1.02,7.012,16]hexadeca-1(16),12,14-triene-4,10-dione |
|---|---|
| PubChem CID | 12789548 |
| Molecular Formula | C12H11N3O3 |
| Molecular Weight | 245.24 g/mol |
| Exact Mass | 245.08 |
| IUPAC Name | (2R,7R)-6-oxa-3,9,11-triazatetracyclo[7.6.1.02,7.012,16]hexadeca-1(16),12,14-triene-4,10-dione |
| SMILES | O=C1CO[C@@H]2Cn3c(=O)[nH]c4cccc(c43)[C@H]2N1 |
| InChI | InChI=1S/C12H11N3O3/c16-9-5-18-8-4-15-11-6(10(8)14-9)2-1-3-7(11)13-12(15)17/h1-3,8,10H,4-5H2,(H,13,17)(H,14,16)/t8-,10-/m1/s1 |
| InChIKey | QAMCYRGGJCBXHO-PSASIEDQSA-N |
| XLogP | -0.10 |
| TPSA | 76.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.24 |
| LogP ≤ 5 | -0.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |