About 2-methyl-N-(2,4,6-trimethylphenyl)buta-1,3-dien-1-imine
2-methyl-N-(2,4,6-trimethylphenyl)buta-1,3-dien-1-imine (PubChem CID 12789626) has the molecular formula C14H17N
and a molecular weight of 199.30 g/mol. Its IUPAC name is 2-methyl-N-(2,4,6-trimethylphenyl)buta-1,3-dien-1-imine.
Molecular Properties
| Compound Name | 2-methyl-N-(2,4,6-trimethylphenyl)buta-1,3-dien-1-imine |
| PubChem CID | 12789626 |
| Molecular Formula | C14H17N |
| Molecular Weight | 199.30 g/mol |
| Exact Mass | 199.14 |
| IUPAC Name | 2-methyl-N-(2,4,6-trimethylphenyl)buta-1,3-dien-1-imine |
| SMILES | C=CC(C)=C=Nc1c(C)cc(C)cc1C |
| InChI | InChI=1S/C14H17N/c1-6-10(2)9-15-14-12(4)7-11(3)8-13(14)5/h6-8H,1H2,2-5H3 |
| InChIKey | CUWDTDXVPFRYLI-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 199.30 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 2-methyl-N-(2,4,6-trimethylphenyl)buta-1,3-dien-1-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-N-(2,4,6-trimethylphenyl)buta-1,3-dien-1-imine?
The IUPAC name of 2-methyl-N-(2,4,6-trimethylphenyl)buta-1,3-dien-1-imine (CID 12789626) is 2-methyl-N-(2,4,6-trimethylphenyl)buta-1,3-dien-1-imine.
What is the SMILES notation for 2-methyl-N-(2,4,6-trimethylphenyl)buta-1,3-dien-1-imine?
The canonical SMILES for 2-methyl-N-(2,4,6-trimethylphenyl)buta-1,3-dien-1-imine is C=CC(C)=C=Nc1c(C)cc(C)cc1C.
What is the InChIKey of 2-methyl-N-(2,4,6-trimethylphenyl)buta-1,3-dien-1-imine?
The InChIKey is CUWDTDXVPFRYLI-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H17N/c1-6-10(2)9-15-14-12(4)7-11(3)8-13(14)5/h6-8H,1H2,2-5H3.
What are the key properties of 2-methyl-N-(2,4,6-trimethylphenyl)buta-1,3-dien-1-imine?
2-methyl-N-(2,4,6-trimethylphenyl)buta-1,3-dien-1-imine has a molecular weight of 199.30 g/mol, XLogP of 4.05, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-N-(2,4,6-trimethylphenyl)buta-1,3-dien-1-imine is sourced from PubChem (CID 12789626), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).