About methyl 2-[3-[3-(trifluoromethyl)phenyl]-4,5-dihydro-1,2-oxazol-5-yl]benzoate
methyl 2-[3-[3-(trifluoromethyl)phenyl]-4,5-dihydro-1,2-oxazol-5-yl]benzoate (PubChem CID 12789635) has the molecular formula C18H14F3NO3
and a molecular weight of 349.31 g/mol. Its IUPAC name is methyl 2-[3-[3-(trifluoromethyl)phenyl]-4,5-dihydro-1,2-oxazol-5-yl]benzoate.
Molecular Properties
| Compound Name | methyl 2-[3-[3-(trifluoromethyl)phenyl]-4,5-dihydro-1,2-oxazol-5-yl]benzoate |
| PubChem CID | 12789635 |
| Molecular Formula | C18H14F3NO3 |
| Molecular Weight | 349.31 g/mol |
| Exact Mass | 349.09 |
| IUPAC Name | methyl 2-[3-[3-(trifluoromethyl)phenyl]-4,5-dihydro-1,2-oxazol-5-yl]benzoate |
| SMILES | COC(=O)c1ccccc1C1CC(c2cccc(C(F)(F)F)c2)=NO1 |
| InChI | InChI=1S/C18H14F3NO3/c1-24-17(23)14-8-3-2-7-13(14)16-10-15(22-25-16)11-5-4-6-12(9-11)18(19,20)21/h2-9,16H,10H2,1H3 |
| InChIKey | RIWBYHKTJYIACN-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 47.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 349.31 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze methyl 2-[3-[3-(trifluoromethyl)phenyl]-4,5-dihydro-1,2-oxazol-5-yl]benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-[3-[3-(trifluoromethyl)phenyl]-4,5-dihydro-1,2-oxazol-5-yl]benzoate?
The IUPAC name of methyl 2-[3-[3-(trifluoromethyl)phenyl]-4,5-dihydro-1,2-oxazol-5-yl]benzoate (CID 12789635) is methyl 2-[3-[3-(trifluoromethyl)phenyl]-4,5-dihydro-1,2-oxazol-5-yl]benzoate.
What is the SMILES notation for methyl 2-[3-[3-(trifluoromethyl)phenyl]-4,5-dihydro-1,2-oxazol-5-yl]benzoate?
The canonical SMILES for methyl 2-[3-[3-(trifluoromethyl)phenyl]-4,5-dihydro-1,2-oxazol-5-yl]benzoate is COC(=O)c1ccccc1C1CC(c2cccc(C(F)(F)F)c2)=NO1.
What is the InChIKey of methyl 2-[3-[3-(trifluoromethyl)phenyl]-4,5-dihydro-1,2-oxazol-5-yl]benzoate?
The InChIKey is RIWBYHKTJYIACN-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H14F3NO3/c1-24-17(23)14-8-3-2-7-13(14)16-10-15(22-25-16)11-5-4-6-12(9-11)18(19,20)21/h2-9,16H,10H2,1H3.
What are the key properties of methyl 2-[3-[3-(trifluoromethyl)phenyl]-4,5-dihydro-1,2-oxazol-5-yl]benzoate?
methyl 2-[3-[3-(trifluoromethyl)phenyl]-4,5-dihydro-1,2-oxazol-5-yl]benzoate has a molecular weight of 349.31 g/mol, XLogP of 4.36, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-[3-[3-(trifluoromethyl)phenyl]-4,5-dihydro-1,2-oxazol-5-yl]benzoate is sourced from PubChem (CID 12789635), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).